
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13304-62-6 |
| Catalog No. | 2A-9035489 |
| Chinese Name | N-苄基丙烯酰胺 |
| Synonyms | N-benzylprop-2-enamide; MFCD00015333; N-Benzylacrylamide |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.2 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 349.5±25.0 °C at 760 mmHg |
| Melting Point | 59-62°C |
| Appearance | Light yellow or white crystals |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| HTC | 2924299090 |
| PubChem ID | 4318696 |
| SMILES | C=CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C10H11NO/c1-2-10(12)11-8-9-6-4-3-5-7-9/h2-7H,1,8H2,(H,11,12) |
| InChI Key | OHLHOLGYGRKZMU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethyl 5-nitroisophthalate | 13290-96-5 | 2A-9035482 |
| Isopropenylmagnesium bromide | 13291-18-4 | 2A-9035483 |
| Borane-methyl sulfide complex | 13292-87-0 | 2A-9035486 |
| 2-Bromo-4-nitroaniline | 13296-94-1 | 2A-9035487 |
| Disperse Orange 76 | 13301-61-6 | 2A-9035488 |
| 3-(Methylthio)-N-phenylaniline | 13313-45-6 | 2A-9035493 |
| 2-Bromo-6-methylphenol | 13319-71-6 | 2A-9035498 |
| 4-Amino-1-butanol | 13325-10-5 | 2A-9035501 |
| 6-Methylpyridazin-3(2H)-one | 13327-27-0 | 2A-9035502 |
| Ethyl 3-methylthiopropionate | 13327-56-5 | 2A-9035504 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA