
CAS Number13236-02-7
Synonyms1,2,3-tris-(2,3-epoxypropoxy)-propane; glyceroltriglycidylether[qr]; Glyceryl triglycidyl ether; glycerinetriglycidylether[qr]; triglycidyl ether of glycerin; POLY/BED(R) 812 EMBEDDING MEDIA; POLY/BED(R) 812; 1,2,3-Tri(glycidyloxy)propane; glycidyl ether of glycerine; TRIGLYCIDYLETHEROFGLYCEROL; glycerin triglycidyl ether; triglycidylglycerol; 1,2,3-Tris(glycidyloxy)propane
Molecular FormulaC12H20O6
Molecular Weight260.28400
Purity98.00%
Density1.251g/cm3
Boiling Point378.7ºC at 760 mmHg
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13236-02-7 |
| Catalog No. | 2A-9035447 |
| Chinese Name | 丙三醇三缩水甘油醚 |
| Synonyms | 1,2,3-tris-(2,3-epoxypropoxy)-propane; glyceroltriglycidylether[qr]; Glyceryl triglycidyl ether; glycerinetriglycidylether[qr]; triglycidyl ether of glycerin; POLY/BED(R) 812 EMBEDDING MEDIA; POLY/BED(R) 812; 1,2,3-Tri(glycidyloxy)propane; glycidyl ether of glycerine; TRIGLYCIDYLETHEROFGLYCEROL; glycerin triglycidyl ether; triglycidylglycerol; 1,2,3-Tris(glycidyloxy)propane |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.28400 |
| Purity | 98.00 |
| Density | 1.251g/cm3 |
| Boiling Point | 378.7ºC at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | room temperature |
| HTC | 2910900090 |
| PubChem ID | 8168726 |
| SMILES | C(OCC1CO1)C(COCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C12H20O6/c1(13-3-10-5-16-10)9(15-7-12-8-18-12)2-14-4-11-6-17-11/h9-12H,1-8H2 |
| InChI Key | SYEWHONLFGZGLK-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-Chlorophenoxy)-2-chlorophenylethanone | 13221-80-2 | 2A-9035437 |
| (4,6-Dimethoxypyrimidin-2-yl)hydrazine | 13223-30-8 | 2A-9035440 |
| 4,6-O-Ethylidene-alpha-D-glucose | 13224-99-2 | 2A-9035443 |
| Aminophenylacetic acid methyl ester | 13226-98-7 | 2A-9035444 |
| Ethylenediaminetetraacetic acid tetrasodium salt | 13235-36-4 | 2A-9035446 |
| 3'-Carboxy-4'-hydroxyacetoacetanilide | 13243-99-7 | 2A-9035450 |
| Cyclohexyl chloroformate | 13248-54-9 | 2A-9035453 |
| Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid | 13252-14-7 | 2A-9035455 |
| 5-(2-Methylthioethyl)hydantoin | 13253-44-6 | 2A-9035457 |
| Carpronium chloride | 13254-33-6 | 2A-9035458 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA