
CAS Number13195-66-9
Synonymsethyl 3-oxidanylidenedecanoate; Decanoic acid,3-oxo-,ethyl ester; 3-Oxo-decansaeure-aethylester; ethyl 2-n-hexylacetoacetate; Decanoic acid, 3-oxo-, ethyl ester; EINECS 236-157-9; Ethyl 3-oxodecanoate; 3-oxo-decanoic acid ethyl ester
Molecular FormulaC12H22O3
Molecular Weight214.3
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point258.8±8.0 °C at 760 mmHg
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13195-66-9 |
| Catalog No. | 2A-9035421 |
| Chinese Name | 3-氧代癸酸乙酯 |
| Synonyms | ethyl 3-oxidanylidenedecanoate; Decanoic acid,3-oxo-,ethyl ester; 3-Oxo-decansaeure-aethylester; ethyl 2-n-hexylacetoacetate; Decanoic acid, 3-oxo-, ethyl ester; EINECS 236-157-9; Ethyl 3-oxodecanoate; 3-oxo-decanoic acid ethyl ester |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.3 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 258.8±8.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918300090 |
| PubChem ID | 10219930 |
| MDL Number | MFCD09025652 |
| SMILES | CCCCCCCC(=O)CC(=O)OCC |
| InChI | InChI=1S/C12H22O3/c1-3-5-6-7-8-9-11(13)10-12(14)15-4-2/h3-10H2,1-2H3 |
| InChI Key | YZKPCVHTRBTTAX-UHFFFAOYSA-N |
| MSDS | msds/35421_1_13195_66_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Vanillyl ethyl ether | 13184-86-6 | 2A-9035409 |
| Zinc methacrylate | 13189-00-9 | 2A-9035411 |
| 2-Bromo-4-methylaniline hydrochloride | 13194-71-3 | 2A-9035418 |
| 1-METHYL-CYCLOBUTYLAMINE | 40571-47-9 | 2A-9035419 |
| Diisopropyl malonate | 13195-64-7 | 2A-9035420 |
| 3-Dimethylamino-1-(2-thienyl)-1-propanone | 13196-35-5 | 2A-9035422 |
| 4-(Methylthio)benzoic acid | 13205-48-6 | 2A-9035424 |
| 2-Nonanamine | 13205-58-8 | 2A-9035425 |
| 1-(3-Hydroxypyridin-2-yl)ethanone | 13210-29-2 | 2A-9035428 |
| 1-(3-Aminopyridin-4-yl)ethanone | 13210-52-1 | 2A-9035429 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA