
CAS Number13167-25-4
Synonyms1-(2,4,6-trichlorphenyl)-1h-pyrrol-2,5-dion; N-(2,4,6-Trichlorophenyl)maleimide; 1-(2,4,6-trichlorophenyl)pyrrole-2,5-dione; EINECS 236-108-1; MFCD06797173; 1-(2,4,6-Trichlorophenyl)-1H-pyrrole-2,5-dione
Molecular FormulaC13H8Cl3NO2
Molecular Weight316.573
Purity98.00%
Density1.7±0.1 g/cm3
Boiling Point400.3±45.0 °C at 760 mmHg
Melting Point134 °C
AppearanceWhite to light yellow crystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13167-25-4 |
| Catalog No. | 2A-9035393 |
| Chinese Name | N-(2,4,6-三氯苯基)马来酰亚胺 |
| Synonyms | 1-(2,4,6-trichlorphenyl)-1h-pyrrol-2,5-dion; N-(2,4,6-Trichlorophenyl)maleimide; 1-(2,4,6-trichlorophenyl)pyrrole-2,5-dione; EINECS 236-108-1; MFCD06797173; 1-(2,4,6-Trichlorophenyl)-1H-pyrrole-2,5-dione |
| Molecular Formula | C13H8Cl3NO2 |
| Molecular Weight | 316.573 |
| Purity | 98.00 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 400.3±45.0 °C at 760 mmHg |
| Melting Point | 134 °C |
| Appearance | White to light yellow crystals |
| Storage Condition | room temperature |
| HTC | 2925190090 |
| PubChem ID | 10219910 |
| MDL Number | MFCD00018383 |
| SMILES | O=C1C=CC(=O)N1c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H4Cl3NO2/c11-5-3-6(12)10(7(13)4-5)14-8(15)1-2-9(14)16/h1-4H |
| InChI Key | VHZJMAJCUAWIHV-UHFFFAOYSA-N |
| MSDS | msds/35393_1_13167_25_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified N-(2,4,6-Trichlorophenyl)maleimide Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-tert-Butylazetidin-3-ol | 13156-04-2 | 2A-9035386 |
| 3beta-Hydroxy-Lup-20(30)-en-28-al | 13159-28-9 | 2A-9035387 |
| N-(2-Pyridyl)nicotinamide | 13160-07-1 | 2A-9035388 |
| 2-Pyridinol-1-oxide | 13161-30-3 | 2A-9035389 |
| 2,4-Undecadienal | 13162-46-4 | 2A-9035392 |
| Bis(4-(tert-butyl)benzoato-O)hydroxyaluminium | 13170-05-3 | 2A-9035394 |
| Di-tert-butoxydiacetoxysilane | 13170-23-5 | 2A-9035395 |
| Hexafluoroisopropyl methyl ether | 13171-18-1 | 2A-9035398 |
| 3-(Dimethyloctadecylazaniumyl)propane-1-sulfonate | 13177-41-8 | 2A-9035404 |
| Vanillyl ethyl ether | 13184-86-6 | 2A-9035409 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA