
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13130-79-5 |
| Catalog No. | 2A-9035369 |
| Chinese Name | 1-溴异喹啉-3-胺 |
| Synonyms | 1-Bromoisoquinolin-3-amine; MFCD00102193; 3-Amino-1-bromoisoquinoline |
| Molecular Formula | C9H7BrN2 |
| Molecular Weight | 223.074 |
| Purity | 96 |
| Density | 1.649g/cm3 |
| Boiling Point | 387.8ºC at 760mmHg |
| Melting Point | 144 °C |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| HTC | 2933499090 |
| PubChem ID | 432554 |
| MDL Number | MFCD00102193 |
| SMILES | Nc1cc2ccccc2c(Br)n1 |
| InChI | InChI=1S/C9H7BrN2/c10-9-7-4-2-1-3-6(7)5-8(11)12-9/h1-5H,(H2,11,12) |
| InChI Key | PSQUIUNIVDKHJK-UHFFFAOYSA-N |
| MSDS | msds/35369_1_13130_79_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| tert-Butyl peroxy-3,5,5-trimethylhexanoate | 13122-18-4 | 2A-9035360 |
| Chlorobenzene-4-D1 | 13122-34-4 | 2A-9035361 |
| 2-Bromobenzene-1,3,5-D3 | 13122-41-3 | 2A-9035362 |
| Rubidium nitrate | 13126-12-0 | 2A-9035365 |
| N-Benzyl-N-methylpiperidinium chloride | 13127-28-1 | 2A-9035367 |
| 2,6-Dibromohexanoic acid | 13137-43-4 | 2A-9035370 |
| Periplocin | 13137-64-9 | 2A-9035371 |
| 3-Aminopropylphosphonic acid | 13138-33-5 | 2A-9035372 |
| 3,3'-Dimethylnaphthidine | 13138-48-2 | 2A-9035373 |
| 4-Nitrophthaldiamide | 13138-53-9 | 2A-9035374 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA