![Bis[4-(4-aminophenoxy)phenyl]sulfone structure, CAS 13080-89-2](/structures/40000/35339_1_13080_89_2.png)
CAS Number13080-89-2
Synonymsbis(4-(4-aminophenoxy)phenyl)sulfone; Bis[4-(4-aminophenoxy)phenyl]sulfone; MFCD00039155; 4,4'-[Sulfonylbis(4,1-phenyleneoxy)]dianiline; Bis[4-(4-aMinophenoxy)phenyl] Sulfone; 4-[4-[4-(4-aminophenoxy)phenyl]sulfonylphenoxy]aniline; EINECS 235-986-3
Molecular FormulaC24H20N2O4S
Molecular Weight432.502
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point655.3±55.0 °C at 760 mmHg
Melting Point195 °C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13080-89-2 |
| Catalog No. | 2A-9035339 |
| Chinese Name | 4,4'-双(4-氨基苯氧基)二苯砜 |
| Synonyms | bis(4-(4-aminophenoxy)phenyl)sulfone; Bis[4-(4-aminophenoxy)phenyl]sulfone; MFCD00039155; 4,4'-[Sulfonylbis(4,1-phenyleneoxy)]dianiline; Bis[4-(4-aMinophenoxy)phenyl] Sulfone; 4-[4-[4-(4-aminophenoxy)phenyl]sulfonylphenoxy]aniline; EINECS 235-986-3 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.502 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 655.3±55.0 °C at 760 mmHg |
| Melting Point | 195 °C |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 3299856 |
| MDL Number | MFCD00039155 |
| SMILES | Nc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H20N2O4S/c25-17-1-5-19(6-2-17)29-21-9-13-23(14-10-21)31(27,28)24-15-11-22(12-16-24)30-20-7-3-18(26)4-8-20/h1-16H,25-26H2 |
| InChI Key | UTDAGHZGKXPRQI-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/35339_1_13080_89_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(3-Chlorophenyl)ethylamine | 13078-79-0 | 2A-9035333 |
| 2-(4-Aminophenyl)ethylamine dihydrochloride | 13078-82-5 | 2A-9035335 |
| 4-Amino-2-phenylbutanoic acid | 13080-10-9 | 2A-9035336 |
| 4,4'-Bis(4-aminophenoxy)biphenyl | 13080-85-8 | 2A-9035337 |
| 4,4'-(4,4'-Isopropylidenediphenyl-1,1'-diyldioxy)dianiline | 13080-86-9 | 2A-9035338 |
| 5-Norbornen-2-ol | 13080-90-5 | 2A-9035340 |
| Ethyl trifluoropyruvate | 13081-18-0 | 2A-9035341 |
| Methyl trifluoropyruvate | 13089-11-7 | 2A-9035343 |
| Ceric nitrate | 13093-17-9 | 2A-9035347 |
| 1-(3-Bromopropoxy)-4-nitrobenzene | 13094-50-3 | 2A-9035348 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA