
CAS Number13036-02-7
SynonymsDimethyl-5-hydroxybenzol-1,3-dicarboxylat; MFCD00134367; Dimethyl 5-hydroxyisophthalate; EINECS 235-899-0; 1,3-Benzenedicarboxylic acid, 5-hydroxy-, dimethyl ester; 5-Hydroxyisophthalic Acid Dimethyl Ester; Dimethyl 5-hydroxybenzene-1,3-dicarboxylate
Molecular FormulaHOC6H3-1,3-(CO2CH3)2
Molecular Weight210.18
Purity98%
Density1.3±0.1 g/cm3
Boiling Point360.6±22.0 °C at 760 mmHg
Melting Point162-164 °C (lit.)
Appearancepowder
EINECS235-899-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13036-02-7 |
| Catalog No. | 2A-9035296 |
| Chinese Name | 5-羟基间苯二甲酸二甲酯 |
| Synonyms | Dimethyl-5-hydroxybenzol-1,3-dicarboxylat; MFCD00134367; Dimethyl 5-hydroxyisophthalate; EINECS 235-899-0; 1,3-Benzenedicarboxylic acid, 5-hydroxy-, dimethyl ester; 5-Hydroxyisophthalic Acid Dimethyl Ester; Dimethyl 5-hydroxybenzene-1,3-dicarboxylate |
| Molecular Formula | HOC6H3-1,3-(CO2CH3)2 |
| Molecular Weight | 210.18 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 360.6±22.0 °C at 760 mmHg |
| Melting Point | 162-164 °C (lit.) |
| Appearance | powder |
| Storage Condition | Sealed and protected from light at room temperatur |
| EINECS | 235-899-0 |
| HTC | 2918199090 |
| PubChem ID | 24863128 |
| MDL Number | MFCD00134367 |
| SMILES | COC(=O)c1cc(O)cc(c1)C(=O)OC |
| InChI | 1S/C10H10O5/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6/h3-5,11H,1-2H3 |
| InChI Key | DOSDTCPDBPRFHQ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2650120 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/35296_1_13036_02_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 5-Hydroxyisophthalate dimethyl ester Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (1-Butyl)triethylammonium bromide | 13028-69-8 | 2A-9035288 |
| 4-Acetylphenyl acetate | 13031-43-1 | 2A-9035290 |
| Methyl 4-aminobutyrate hydrochloride | 13031-60-2 | 2A-9035291 |
| D-Phenylalanine methyl ester hydrochloride | 13033-84-6 | 2A-9035292 |
| Potassium 4-iodobenzenesulfonate | 13035-63-7 | 2A-9035295 |
| 4-Heptyloxyphenol | 13037-86-0 | 2A-9035298 |
| 5-Deoxy-D-ribose | 13039-75-3 | 2A-9035299 |
| 1,4:3,6-Dianhydro-D-glucitol 2-acetate | 13042-39-2 | 2A-9035300 |
| Dimezone S | 13047-13-7 | 2A-9035301 |
| Hexamethylene diacrylate | 13048-33-4 | 2A-9035302 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA