CAS Number10589-94-3
Synonyms21H,23H-Porphine-2,18-dipropanoic acid, 3,8,13,17-tetramethyl-, dimethyl ester; DPIX dimethyl ester; Deuteroporphyrindimethylester; Dimethyl-3,7,12,17-tetramethyl-21H,23H-porphine-2,18-dipropionate; deuteroporfirin dimethyl ester; deuteroporphyrin IX methyl ester; Dimethyl 3,3'-(3,7,12,17-tetramethyl-2,18-porphyrindiyl)dipropanoate; deuteroporphyrin IX dimethyl ester; MFCD00010033; Dimethyl 3,3'-(3,7,12,17-tetramethylporphyrin-2,18-diyl)dipropanoate; 21H,23H-Porphine-2,18-dipropanoicacid, 3,7,12,17-tetramethyl-, 2,18-dimethyl ester; EINECS 234-195-0
Molecular FormulaC32H34N4O4
Molecular Weight538.64
Purity90%
Density1.2±0.1 g/cm3
Boiling Point996.4±65.0 °C at 760 mmHg
Melting Point217-220 °C (lit.)
Appearancesolid
EINECS234-195-0
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10589-94-3 |
| Catalog No. | 2A-9034958 |
| Chinese Name | 次卟啉二甲酯 |
| Synonyms | 21H,23H-Porphine-2,18-dipropanoic acid, 3,8,13,17-tetramethyl-, dimethyl ester; DPIX dimethyl ester; Deuteroporphyrindimethylester; Dimethyl-3,7,12,17-tetramethyl-21H,23H-porphine-2,18-dipropionate; deuteroporfirin dimethyl ester; deuteroporphyrin IX methyl ester; Dimethyl 3,3'-(3,7,12,17-tetramethyl-2,18-porphyrindiyl)dipropanoate; deuteroporphyrin IX dimethyl ester; MFCD00010033; Dimethyl 3,3'-(3,7,12,17-tetramethylporphyrin-2,18-diyl)dipropanoate; 21H,23H-Porphine-2,18-dipropanoicacid, 3,7,12,17-tetramethyl-, 2,18-dimethyl ester; EINECS 234-195-0 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.64 |
| Purity | 90 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 996.4±65.0 °C at 760 mmHg |
| Melting Point | 217-220 °C (lit.) |
| Appearance | solid |
| Storage Condition | Sealed in a cool, dry environment |
| Application | Bis-porphyrin dimethyl ester is a biochemical reagent that can be used as a biological material or organic compound for life science-related research. |
| EINECS | 234-195-0 |
| PubChem ID | 24867609 |
| MDL Number | MFCD00010033 |
| SMILES | COC(=O)CCc1c(C)c2cc3[nH]c(cc3C)cc4nc(cc4C)cc5[nH]c(cc1n2)c(CCC(=O)OC)c5C |
| InChI | 1S/C32H34N4O4/c1-17-11-22-14-27-19(3)23(7-9-31(37)39-5)29(35-27)16-30-24(8-10-32(38)40-6)20(4)28(36-30)15-26-18(2)12-21(34-26)13-25(17)33-22/h11-16,34-35H,7-10H2,1-6H3/b21-13-,22-14-,25-13-,26-15-,27-14-,28-15-,29-16-,30-16- |
| InChI Key | JDWKDJYBNJTDOW-RWJCOFQGSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12161600 |
| MSDS | msds/34958_1_10589_94_3.pdf |
| Transport Info | Product name: Hypoporphyrin dimethyl ester |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Ethyl-1,3-propanediamine | 10563-23-2 | 2A-9034950 |
| N,N'-Bis(2-Hydroxyethyl)propane-1,3-diamine | 10563-27-6 | 2A-9034951 |
| DL-3-Aminoisobutyric acid | 10569-72-9 | 2A-9034954 |
| Ethyl acetohydroxamate | 10576-12-2 | 2A-9034955 |
| Tetramethylammonium acetate | 10581-12-1 | 2A-9034956 |
| Ditridecyl 3,3'-thiodipropionate | 10595-72-9 | 2A-9034962 |
| 2-Sulfoethyl methacrylate | 10595-80-9 | 2A-9034963 |
| N-Acetylmuramic acid | 10597-89-4 | 2A-9034965 |
| Ethyl 3,3-diethoxypropionate | 10601-80-6 | 2A-9034969 |
| 4-Ethynylbenzoic acid | 10602-00-3 | 2A-9034970 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS