
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10557-21-8 |
| Catalog No. | 2A-9034946 |
| Chinese Name | 1-(4-氯苯基)-1,2-丙二酮 |
| Synonyms | MFCD01941300; 1-(4-Chlorophenyl)propane-1,2-dione |
| Molecular Formula | C9H7O2Cl1 |
| Molecular Weight | 182.61 |
| Purity | 98.00 |
| Density | 1.246g/cm3 |
| Boiling Point | 60-65/0.02bar |
| Melting Point | 30-32ºC |
| HTC | 2914700090 |
| PubChem ID | 3158564 |
| MDL Number | MFCD01941300 |
| SMILES | CC(=O)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H7ClO2/c1-6(11)9(12)7-2-4-8(10)5-3-7/h2-5H,1H3 |
| InChI Key | HOZREFFNUJAHQP-UHFFFAOYSA-N |
| MSDS | msds/34946_1_10557_21_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Methyl-2-anisidine | 10541-78-3 | 2A-9034936 |
| 4-(Methylamino)benzoic acid | 10541-83-0 | 2A-9034937 |
| 4-Acetoxy-3-methoxybenzoic acid | 10543-12-1 | 2A-9034938 |
| Tetraacetylethylenediamine | 10543-57-4 | 2A-9034940 |
| N,N',N'',N'''-Tetraacetylglycoluril | 10543-60-9 | 2A-9034941 |
| N-Ethyl-1,3-propanediamine | 10563-23-2 | 2A-9034950 |
| N,N'-Bis(2-Hydroxyethyl)propane-1,3-diamine | 10563-27-6 | 2A-9034951 |
| DL-3-Aminoisobutyric acid | 10569-72-9 | 2A-9034954 |
| Ethyl acetohydroxamate | 10576-12-2 | 2A-9034955 |
| Tetramethylammonium acetate | 10581-12-1 | 2A-9034956 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA