
CAS Number10441-41-5
Synonyms1-(6-hydroxy-2-naphthyl)-1-ethanone; 2-acetyl-6-hydroxynaphthalene; 6-ACETYL-2-NAPHTHOL; 1-(6-Hydroxy-2-naphthyl)ethan-1-one; 1-(6-Hydroxy-2-naphthyl)ethanone; 6-hydroxy-2-acetyl-naphthalene
Molecular FormulaC12H10O2
Molecular Weight186.21
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point370.1±15.0 °C at 760 mmHg
AppearanceOff-white to light yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10441-41-5 |
| Catalog No. | 2A-9034881 |
| Chinese Name | 6-乙酰基-2-萘酚 |
| Synonyms | 1-(6-hydroxy-2-naphthyl)-1-ethanone; 2-acetyl-6-hydroxynaphthalene; 6-ACETYL-2-NAPHTHOL; 1-(6-Hydroxy-2-naphthyl)ethan-1-one; 1-(6-Hydroxy-2-naphthyl)ethanone; 6-hydroxy-2-acetyl-naphthalene |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 370.1±15.0 °C at 760 mmHg |
| Appearance | Off-white to light yellow solid |
| Storage Condition | room temperature, inert gas |
| HTC | 2914501900 |
| PubChem ID | 426145 |
| MDL Number | MFCD00127709 |
| SMILES | CC(=O)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C12H10O2/c1-8(13)9-2-3-11-7-12(14)5-4-10(11)6-9/h2-7,14H,1H3 |
| InChI Key | IWRHUCBSLVVLJD-UHFFFAOYSA-N |
| MSDS | msds/34881_1_10441_41_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2914501900 other ketone-phenols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tetramethylammonium hydroxide pentahydrate | 10424-65-4 | 2A-9034875 |
| N-Benzyl-N,N-bis(2-chloroethyl)amine hydrochloride | 10429-82-0 | 2A-9034877 |
| 2-Ethyl-2-oxazoline | 10431-98-8 | 2A-9034878 |
| cis-11-Eicosenamide | 10436-08-5 | 2A-9034879 |
| S-(2-Methylphenyl) ethanethioate | 10436-57-4 | 2A-9034880 |
| HC Yellow 13 | 10442-83-8 | 2A-9034882 |
| Periodic acid | 10450-60-9 | 2A-9034885 |
| (3alpha,5beta,6alpha,12alpha)-3,12-Bis(acetyloxy)-6-bromo-7-oxocholan-24-oic acid methyl ester | 10452-63-8 | 2A-9034886 |
| Menthone | 10458-14-7 | 2A-9034888 |
| 4-Hydroxy-3-nitrophenylacetic acid | 10463-20-4 | 2A-9034889 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA