
CAS Number10415-88-0
Synonyms2-Butanol,4-phenyl-,acetate; 1-Phenyl-3-acetoxybutane; 1-methyl-3-phenylpropyl acetate; 3-phenyl-1-methyl-propyl acetate; (S)-1-phenyl-3-butanol acetate; (RS)-1-phenyl-3-butanol acetate; Phenylethyl methyl carbinyl acetate; 4-Phenyl-2-butyl acetate; (S)-4-phenyl-2-butyl acetate; trans-2-acetoxy-4-phenylbutane; 4-Phenylbut-2-yl acetate
Molecular FormulaC12H16O2
Molecular Weight192.26
Purity98.00%
Density0.991
Boiling Point72-74ºC (0.5 mmHg)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10415-88-0 |
| Catalog No. | 2A-9034866 |
| Chinese Name | 乙酸-(4-苯基)-2-丁酯 |
| Synonyms | 2-Butanol,4-phenyl-,acetate; 1-Phenyl-3-acetoxybutane; 1-methyl-3-phenylpropyl acetate; 3-phenyl-1-methyl-propyl acetate; (S)-1-phenyl-3-butanol acetate; (RS)-1-phenyl-3-butanol acetate; Phenylethyl methyl carbinyl acetate; 4-Phenyl-2-butyl acetate; (S)-4-phenyl-2-butyl acetate; trans-2-acetoxy-4-phenylbutane; 4-Phenylbut-2-yl acetate |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 |
| Purity | 98.00 |
| Density | 0.991 |
| Boiling Point | 72-74ºC (0.5 mmHg) |
| HTC | 2915390090 |
| PubChem ID | 3137943 |
| MDL Number | MFCD00026203 |
| SMILES | CC(=O)OC(C)CCc1ccccc1 |
| InChI | InChI=1S/C12H16O2/c1-10(14-11(2)13)8-9-12-6-4-3-5-7-12/h3-7,10H,8-9H2,1-2H3 |
| InChI Key | IVEWTAOGAGBQGG-UHFFFAOYSA-N |
| MSDS | msds/34866_1_10415_88_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-5-nitroaniline | 10403-47-1 | 2A-9034857 |
| 1,2-Di(phenoxymethyl)benzene | 10403-74-4 | 2A-9034858 |
| Trospium chloride | 10405-02-4 | 2A-9034859 |
| 3-Cyanobenzylamine | 10406-24-3 | 2A-9034862 |
| 4-Cyanobenzylamine | 10406-25-4 | 2A-9034863 |
| Dimethyl acetylsuccinate | 10420-33-4 | 2A-9034869 |
| 1-Bromo-2-methylbutane | 10422-35-2 | 2A-9034874 |
| Tetramethylammonium hydroxide pentahydrate | 10424-65-4 | 2A-9034875 |
| N-Benzyl-N,N-bis(2-chloroethyl)amine hydrochloride | 10429-82-0 | 2A-9034877 |
| 2-Ethyl-2-oxazoline | 10431-98-8 | 2A-9034878 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA