
CAS Number10305-73-4
Synonyms(1R)-Indan-1-amine hydrochloride (1:1); (R)-(-)-1-Aminoindane hydrochloride; (R)-(-)-1-Aminoindanehydrochloride; 1H-Inden-1-amine, 2,3-dihydro-, (1R)-, hydrochloride (1:1); (1R)-2,3-dihydro-1H-inden-1-amine,hydrochloride; (1R)-1-Indanamine hydrochloride (1:1); (R)-2,3-Dihydro-1H-inden-1-amine hydrochloride
Molecular FormulaC9H12ClN
Molecular Weight169.65
Purity98.00%
Melting Point232-234ºC
AppearanceWhite to light yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10305-73-4 |
| Catalog No. | 2A-9034780 |
| Chinese Name | (R)-1-氨基茚满盐酸盐 |
| Synonyms | (1R)-Indan-1-amine hydrochloride (1:1); (R)-(-)-1-Aminoindane hydrochloride; (R)-(-)-1-Aminoindanehydrochloride; 1H-Inden-1-amine, 2,3-dihydro-, (1R)-, hydrochloride (1:1); (1R)-2,3-dihydro-1H-inden-1-amine,hydrochloride; (1R)-1-Indanamine hydrochloride (1:1); (R)-2,3-Dihydro-1H-inden-1-amine hydrochloride |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 |
| Purity | 98.00 |
| Melting Point | 232-234ºC |
| Appearance | White to light yellow powder |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2921499090 |
| PubChem ID | 85202952 |
| InChI | InChI=1S/C9H11N.ClH/c10-9-6-5-7-3-1-2-4-8(7)9;/h1-4,9H,5-6,10H2;1H/t9-;/m1./s1 |
| InChI Key | RHAAGWRBIVCBSY-SBSPUUFOSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| Polymethylene polyphenyl polyisocyanate | 9016-87-9 | 2A-9034484 |
| 3-Methoxybenzenesulfonyl chloride | 10130-74-2 | 2A-9034672 |
| (2S,3R)-(+)-2-Amino-3-hydroxy-4-methylpentanoic acid | 10148-71-7 | 2A-9034687 |
| 2-Hydroxy-1,5-naphthyridine | 10261-82-2 | 2A-9034750 |
| (R)-(-)-1-Aminoindan | 10277-74-4 | 2A-9034759 |
| (S)-Methyl 2-methylbutyrate | 10307-60-5 | 2A-9034781 |
| (R)-Lactate | 10326-41-7 | 2A-9034797 |
| N,N'-Bis(tert-butoxycarbonyl)-L-cystine | 10389-65-8 | 2A-9034845 |
| (S)-(-)-1-(1-Naphthyl)ethylamine | 10420-89-0 | 2A-9034871 |
| (2S,3S)-3-Methylpyrrolidine-2-carboxylic acid | 10512-89-7 | 2A-9034920 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA