
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10250-64-3 |
| Catalog No. | 2A-9034744 |
| Chinese Name | 1-甲基-3-苯基-1H-吡唑-5-羧酸 |
| Synonyms | 2-methyl-5-phenylpyrazole-3-carboxylic acid |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 |
| Purity | 98.00 |
| Density | 1.24g/cm3 |
| Boiling Point | 419.6ºC at 760mmHg |
| Melting Point | 186ºC |
| Appearance | solid |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933199090 |
| PubChem ID | 329815812 |
| MDL Number | MFCD08271939 |
| SMILES | Cn1nc(cc1C(O)=O)-c2ccccc2 |
| InChI | 1S/C11H10N2O2/c1-13-10(11(14)15)7-9(12-13)8-5-3-2-4-6-8/h2-7H,1H3,(H,14,15) |
| InChI Key | RTBQZMPYPFQBHA-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/34744_1_10250_64_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Amino-4-methoxypyridine | 10201-73-7 | 2A-9034717 |
| 4-(2-Methoxyethyl)morpholine | 10220-23-2 | 2A-9034728 |
| 5-Methylindole-2-carboxylic acid | 10241-97-1 | 2A-9034740 |
| 5-Methoxy-3-indolecarboxylic acid | 10242-01-0 | 2A-9034741 |
| 5-Methoxybenzofuran-2-carboxylic acid | 10242-08-7 | 2A-9034742 |
| 4-(Morpholine-4-sulfonyl)benzoic acid | 10252-82-1 | 2A-9034745 |
| Sodium 3-indolebutyrate | 10265-70-0 | 2A-9034753 |
| 3-Methyl-2-phenylpyridine | 10273-90-2 | 2A-9034757 |
| 3-Hydroxy-4-(N,N-dimethylamino)tetrahydrofuran | 10295-90-6 | 2A-9034775 |
| Methyl 1-benzylpiperidine-4-carboxylate | 10315-06-7 | 2A-9034789 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA