
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 606-26-8 |
| Catalog No. | 2A-9003461 |
| Chinese Name | 2-硝基苄肼 |
| Synonyms | 2-nitrobenzohydrazide; EINECS 210-110-2; MFCD00007598 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.14900 |
| Purity | 98 |
| Density | 1.406g/cm3 |
| Melting Point | 121-123°C |
| Appearance | Solid;White to Orange to Green powder to crystal |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2928000090 |
| SMILES | NNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
| InChI Key | LYGGDXLOJMNFBV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Naphthhydrazide | 39627-84-4 | 2A-9003435 |
| 2-Nitro-4-(trifluoromethyl)phenol | 400-99-7 | 2A-9003444 |
| 2-Nitro-4-trifluoromethylbenzoic acid | 320-94-5 | 2A-9003447 |
| 2-Nitro-4-trifluoromethylbenzonitrile | 778-94-9 | 2A-9003448 |
| 2-Nitrobenzaldehyde | 552-89-6 | 2A-9003456 |
| 2-Oxo-4-trifluoromethyl-2,5,6,7-tetrahydro-1H-[1]pyridindine-3-carbonitrile | 2A-103484 | 2A-9003486 |
| o-Phthalaldehyde | 643-79-8 | 2A-9003504 |
| 2-Trifluoromethyl-9-thioxanthone | 1693-28-3 | 2A-9003533 |
| 2-Trifluoromethylbenzoic acid | 433-97-6 | 2A-9003534 |
| 2-Trifluoromethylbenzyl bromide | 395-44-8 | 2A-9003535 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA