
CAS Number51557-26-7
Synonyms3-(2-Naphthyl)acrylic acid; (2E)-3-(2-Naphthyl)acrylic acid; (2E)-3-(naphthalen-2-yl)prop-2-enoic acid; MFCD00209666; 2-Naphthylacrylic acid; 3-(Naphthalen-2-yl)acrylic acid
Molecular FormulaC13H10O2
Molecular Weight198.217
Purity98%
Density1.2±0.1 g/cm3
Boiling Point393.1±11.0 °C at 760 mmHg
Melting Point210-212°C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51557-26-7 |
| Catalog No. | 2A-9003439 |
| Chinese Name | 3-(2-萘基)丙烯酸 |
| Synonyms | 3-(2-Naphthyl)acrylic acid; (2E)-3-(2-Naphthyl)acrylic acid; (2E)-3-(naphthalen-2-yl)prop-2-enoic acid; MFCD00209666; 2-Naphthylacrylic acid; 3-(Naphthalen-2-yl)acrylic acid |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.217 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 393.1±11.0 °C at 760 mmHg |
| Melting Point | 210-212°C |
| Appearance | powder |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2916399090 |
| SMILES | O=C(O)C=Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H10O2/c14-13(15)8-6-10-5-7-11-3-1-2-4-12(11)9-10/h1-9H,(H,14,15)/p-1/b8-6- |
| InChI Key | KWGPBDBAAXYWOJ-SOFGYWHQSA-N |
| MSDS | msds/3439_1_51557_26_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-N,N-Methylacetylamino-5-nitrobenophenone | 103697-03-6 | 2A-9003426 |
| 2-Naphthalen-2-yl-benzooxazol-5-yl-amine | 95888-12-3 | 2A-9003428 |
| 2-Naphthoxyacetic acid | 2976-75-2 | 2A-9003436 |
| 2-Naphthoyl chloride | 2243-83-6 | 2A-9003437 |
| 2-Naphthylacetonitrile | 7498-57-9 | 2A-9003438 |
| 2-Naphthylamine-3,6,8-trisulfonic acid | 118-03-6 | 2A-9003440 |
| 2-Naphthylamine-4,6,8-trisulfonic acid | 27310-25-4 | 2A-9003441 |
| 2-Nitro sodium benzenesulfonate | 2A-103443 | 2A-9003443 |
| 2-Nitro-4-methylsulfonylbenzoic acid | 110964-79-9 | 2A-9003445 |
| 2-Nitro-4-thiocyanatoaniline | 54029-45-7 | 2A-9003446 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA