
CAS Number9001-99-4
SynonymsRibonuclease A; MFCD00132181; 2-[(3-Aminopropanoyl)amino]-3-(1H-imidazol-4-yl)propanoic acid; b-Alanylhistidine; β-Alanylhistidine; carnosine; EINECS 232-646-6; N-(3-Aminopropanoyl)histidine
Molecular FormulaC9H14N4O3
Molecular Weight226.232
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point656.2±55.0 °C at 760 mmHg
Melting Point243 ºC (dec.)
EINECS232-646-6
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 9001-99-4 |
| Catalog No. | 2A-9034378 |
| Chinese Name | 核糖核酸酶 A |
| Synonyms | Ribonuclease A; MFCD00132181; 2-[(3-Aminopropanoyl)amino]-3-(1H-imidazol-4-yl)propanoic acid; b-Alanylhistidine; β-Alanylhistidine; carnosine; EINECS 232-646-6; N-(3-Aminopropanoyl)histidine |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.232 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 656.2±55.0 °C at 760 mmHg |
| Melting Point | 243 ºC (dec.) |
| Storage Condition | Airtight and dry, store at 0~40C |
| Application | RNase A cleaves RNA 3′ into pyrimidines and actively cleaves RNA at each pyrimidine residue. RNase A catalyzes the hydrolysis of single-stranded RNA in the absence of metal ions or cofactors [1][2][3] |
| EINECS | 232-646-6 |
| PubChem ID | 481668 |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) |
| InChI Key | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| Transport Info | Product name: Ribonuclease A derived from bovine pancreas |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Lipase | 9001-62-1 | 2A-9034373 |
| Malate dehydrogenase | 9001-64-3 | 2A-9034374 |
| Papain | 9001-73-4 | 2A-9034375 |
| Pepsin | 9001-75-6 | 2A-9034376 |
| Alkaline phosphatase | 9001-78-9 | 2A-9034377 |
| Thrombin | 9002-04-4 | 2A-9034379 |
| Trypsin | 9002-07-7 | 2A-9034380 |
| Urease | 9002-13-5 | 2A-9034381 |
| Xanthine oxidase | 9002-17-9 | 2A-9034382 |
| Corticotropin | 9002-60-2 | 2A-9034384 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA