CAS Number7778-83-8
SynonymsPropyl ciamate; propyl 3-phenyl-2-propenoate; Zimtsaeurepropylester; EINECS 231-916-0; cinnamic acid propyl ester; Zimtsaeure-n-propylester; MFCD00051556; Propyl (2E)-3-phenylacrylate; FEMA 2938; Propyl 3-phenylpropenoate; n-Propylcinnamate; propylesterkyselinyskoricove
Molecular FormulaC12H14O2
Molecular Weight190.24
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point286.2±9.0 °C at 760 mmHg
AppearanceColorless, viscous liquid that solidifies into crystals when cooled
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7778-83-8 |
| Catalog No. | 2A-9034041 |
| Chinese Name | 肉桂酸正丙酯 |
| Synonyms | Propyl ciamate; propyl 3-phenyl-2-propenoate; Zimtsaeurepropylester; EINECS 231-916-0; cinnamic acid propyl ester; Zimtsaeure-n-propylester; MFCD00051556; Propyl (2E)-3-phenylacrylate; FEMA 2938; Propyl 3-phenylpropenoate; n-Propylcinnamate; propylesterkyselinyskoricove |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 286.2±9.0 °C at 760 mmHg |
| Appearance | Colorless, viscous liquid that solidifies into crystals when cooled |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| HTC | 2916399090 |
| PubChem ID | 8596 |
| MDL Number | MFCD00051556 |
| SMILES | CCCOC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C12H14O2/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3/b9-8+ |
| InChI Key | OLLPXZHNCXACMM-CMDGGOBGSA-N |
| MSDS | msds/34041_1_7778_83_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DARUTOSIDE | 59219-65-7 | 2A-9034027 |
| Silver fluoride | 7775-41-9 | 2A-9034030 |
| L-Proline hydrochloride | 7776-34-3 | 2A-9034031 |
| L-Fructose | 7776-48-9 | 2A-9034032 |
| Potassium hypochlorite | 7778-66-7 | 2A-9034037 |
| 1,2-Dimethoxypropane | 7778-85-0 | 2A-9034042 |
| 1,1-Dimethoxydecane | 7779-41-1 | 2A-9034044 |
| Isoamyl cinnamate | 7779-65-9 | 2A-9034045 |
| Isobornyl isovalerate | 7779-73-9 | 2A-9034046 |
| Isobutyl anthranilate | 7779-77-3 | 2A-9034048 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS