
CAS Number108124-17-0
Synonyms2-methyl-5-phenyl-3-furoic acid; 2-methyl-5-phenyl-furan-3-carboxylic acid; 2-methyl-5-phenyl-3-furancarboxylic acid; 2-methyl-5-phenylfuranoic acid; MFCD00221070; 2-Methyl-5-phenyl-furan-3-carbonsaeure; 5-phenyl-2-methyl-3-furancarboxylic acid
Molecular FormulaC12H10O3
Molecular Weight202.21
Purity≥98 (HPLC)%
Density1.215g/cm3
Boiling Point357.1ºC at 760mmHg
Melting Point176 °C
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 108124-17-0 |
| Catalog No. | 2A-9003399 |
| Chinese Name | 2-甲基-5-苯基-3-糠酸 |
| Synonyms | 2-methyl-5-phenyl-3-furoic acid; 2-methyl-5-phenyl-furan-3-carboxylic acid; 2-methyl-5-phenyl-3-furancarboxylic acid; 2-methyl-5-phenylfuranoic acid; MFCD00221070; 2-Methyl-5-phenyl-furan-3-carbonsaeure; 5-phenyl-2-methyl-3-furancarboxylic acid |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 |
| Purity | ≥98 (HPLC) |
| Density | 1.215g/cm3 |
| Boiling Point | 357.1ºC at 760mmHg |
| Melting Point | 176 °C |
| Appearance | powder |
| Storage Condition | Sealed and stored in a cool, dry warehouse. Keep a |
| HTC | 2932190090 |
| SMILES | [O-]C(=O)c1c([o]c(c1)c2ccccc2)C |
| InChI | 1S/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)/p-1 |
| InChI Key | VLMNACSEESRUAK-UHFFFAOYSA-M |
| NACRES Code | NA.77 |
| UNSPSC | 12352302 |
| MSDS | msds/3399_1_108124_17_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methyl-5-chloroanisole | 40794-04-5 | 2A-9003391 |
| 2-Methyl-5-hydroxyethylaminophenol | 55302-96-0 | 2A-9003395 |
| 2-Methyl-5-nitro-6-chlorophenol | 39183-20-5 | 2A-9003396 |
| 2-Methyl-5-nitroanisole | 13120-77-9 | 2A-9003397 |
| 2-Methyl-5-nitrophenol | 5248-54-6 | 2A-9003398 |
| 2-Methylaminoaniline hydrochloride | 25148-68-9 | 2A-9003402 |
| 2-Methylbenzophenone | 131-58-8 | 2A-9003403 |
| 2-Methylbenzotrifluoride | 13630-19-8 | 2A-9003404 |
| 2-Methylcinnamic acid | 2373-76-4 | 2A-9003406 |
| 2-Methylcyclohexylamine | 7003-32-9 | 2A-9003407 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA