
CAS Number7658-80-2
Synonyms6-{(E)-[(4-Methylphenyl)imino]methyl}-1,3-benzodioxol-5-amine; 2-methylbenzohydrazide; MFCD00014756; EINECS 231-623-8
Molecular FormulaC15H14N2O2
Molecular Weight254.284
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point448.5±45.0 °C at 760 mmHg
Melting Point121-125 °C
AppearanceOff-white to light beige powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7658-80-2 |
| Catalog No. | 2A-9033867 |
| Chinese Name | 2-甲苯甲酰肼 |
| Synonyms | 6-{(E)-[(4-Methylphenyl)imino]methyl}-1,3-benzodioxol-5-amine; 2-methylbenzohydrazide; MFCD00014756; EINECS 231-623-8 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.284 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 448.5±45.0 °C at 760 mmHg |
| Melting Point | 121-125 °C |
| Appearance | Off-white to light beige powder |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| HTC | 2928000090 |
| SMILES | Cc1ccccc1C(=O)NN |
| InChI | InChI=1S/C8H10N2O/c1-6-4-2-3-5-7(6)8(11)10-9/h2-5H,9H2,1H3,(H,10,11) |
| InChI Key | KFXLXEQCRFGDRU-UHFFFAOYSA-N |
| MSDS | msds/33867_1_7658_80_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl azide | 7408-41-5 | 2A-9033631 |
| Triethyl 1,1,2-ethanetricarboxylate | 7459-46-3 | 2A-9033706 |
| 3-Phenanthrenecarboxylic acid | 7470-14-6 | 2A-9033721 |
| 2-Bromo-5-methoxybenzaldehyde | 7507-86-0 | 2A-9033762 |
| cis-1-Propene-1-boronic acid | 7547-96-8 | 2A-9033784 |
| 3-Cyclopentene-1-carboxylic acid | 7686-77-3 | 2A-9033903 |
| 5-Chloro-2-hydroxy-3-methoxybenzaldehyde | 7740-05-8 | 2A-9033971 |
| 4-Hydroxy-1-naphthaldehyde | 7770-45-8 | 2A-9034016 |
| 3-(Bromomethyl)-1,1-difluorocyclobutane | 2A-125459 | 2A-9034036 |
| 3-Ethoxypropionaldehyde diethyl acetal | 7789-92-6 | 2A-9034146 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA