
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7644-03-3 |
| Catalog No. | 2A-9033846 |
| Chinese Name | 2-氨基-4'-氯苯乙酮 |
| Synonyms | 2-Amino-1-(4-chlor-phenyl)-aethanon; 2-AMINO-1-(4-CHLORO-PHENYL)-ETHANONE; MFCD01123946; 2-aMino-1-(4-chlorophenyl)ethan-1-one |
| Molecular Formula | C8H8O1N1Cl1 |
| Molecular Weight | 169.61 |
| Purity | 98.00 |
| Density | 1.241 g/cm3 |
| Boiling Point | 301.6ºC at 760 mmHg |
| HTC | 2922399090 |
| MDL Number | MFCD11848240 |
| SMILES | NCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H8ClNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4H,5,10H2/p+1 |
| InChI Key | KIFWACLIANOVDG-UHFFFAOYSA-N |
| MSDS | msds/33846_1_7644_03_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(4-Aminophenyl)-1H-benzimidazol-5-amine | 7621-86-5 | 2A-9033834 |
| 2-Chloropropionyl chloride | 7623-09-8 | 2A-9033835 |
| Silicon dioxide | 7631-86-9 | 2A-9033836 |
| 2-Methylthiophenothiazine | 7643-08-5 | 2A-9033844 |
| L-(-)-Arabitol | 7643-75-6 | 2A-9033845 |
| 2-Amino-4'-bromoacetophenone | 7644-04-4 | 2A-9033847 |
| Potassium bisulfate | 7646-93-7 | 2A-9033852 |
| Ethyl iododifluoroacetate | 7648-30-8 | 2A-9033859 |
| Benzyldiphenylphosphine | 7650-91-1 | 2A-9033860 |
| Isoquinolin-6-ol | 7651-82-3 | 2A-9033862 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA