
CAS Number7595-31-5
Synonyms2-nitro-4,5-dimethoxyaniline; 3,4-dimethoxy-6-nitroaniline; 4,5-dimethoxy-2-amino-1-nitrobenzene; dimethoxynitroaniline; 4-amino-5-nitroveratrol; 4,5-dimethoxy-2-nitrophenylamine; 4-amino-5-nitroveratrole
Molecular FormulaC8H10N2O4
Molecular Weight198.18
Purity98.00%
Density1.307 g/cm3
Boiling Point383ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7595-31-5 |
| Catalog No. | 2A-9033816 |
| Chinese Name | 2-硝基-4,5-二甲氧基苯胺 |
| Synonyms | 2-nitro-4,5-dimethoxyaniline; 3,4-dimethoxy-6-nitroaniline; 4,5-dimethoxy-2-amino-1-nitrobenzene; dimethoxynitroaniline; 4-amino-5-nitroveratrol; 4,5-dimethoxy-2-nitrophenylamine; 4-amino-5-nitroveratrole |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 |
| Purity | 98.00 |
| Density | 1.307 g/cm3 |
| Boiling Point | 383ºC at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, inert gas |
| HTC | 2922299090 |
| MDL Number | MFCD00087550 |
| SMILES | COc1cc(N)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C8H10N2O4/c1-13-7-3-5(9)6(10(11)12)4-8(7)14-2/h3-4H,9H2,1-2H3 |
| InChI Key | LDAJFLKWQVYIFG-UHFFFAOYSA-N |
| MSDS | msds/33816_1_7595_31_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DL-2-Phenylglycinol | 7568-92-5 | 2A-9033803 |
| Disodium 4-dodecyl-2,4'-oxydibenzenesulfonate | 7575-62-4 | 2A-9033807 |
| Dibenzyl oxalate | 7579-36-4 | 2A-9033810 |
| Lithium hydride | 7580-67-8 | 2A-9033811 |
| Zirconium acetate | 7585-20-8 | 2A-9033813 |
| Ethyl 3-amino-3-oxopropanoate | 7597-56-0 | 2A-9033819 |
| Ethyl 2-(1-benzothiophen-3-yl)acetate | 7597-68-4 | 2A-9033820 |
| 2,5-Dichloro-3-hydroxy-6-methoxybenzoic acid | 7600-50-2 | 2A-9033824 |
| Sodium perchlorate | 7601-89-0 | 2A-9033826 |
| Ethyl (phenylthio)acetate | 7605-25-6 | 2A-9033828 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA