
CAS Number7575-35-1
Synonyms4-[di(2-hydroxyethyl)amino]-aniline; 4-amino-N,N-di-hydroxyethyl aniline; 2,2'-(P-AMINOPHENYLIMINO)DIETHANOL; 2,2'-(4-Aminophenylimino)diethanol; 2-[(4-aminophenyl)(2-hydroxyethyl)amino]ethan-1-ol; 2-[(4-Amino-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol; N,N-[bis-(2-hydroxyethyl)]-p-phenylenediamine
Molecular FormulaCH3C6H4N(CH2CH2OH)2
Molecular Weight195.26
Purity≥97.0 (NT)%
Density1.244 g/cm3
Boiling Point338-340 °C (lit.)
Melting Point49-53 °C (lit.)
Appearancesolid
EINECS221-359-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7575-35-1 |
| Catalog No. | 2A-9033806 |
| Chinese Name | 2,2'-((4-氨基苯基)氮杂二烷基)双(乙烷-1-醇) |
| Synonyms | 4-[di(2-hydroxyethyl)amino]-aniline; 4-amino-N,N-di-hydroxyethyl aniline; 2,2'-(P-AMINOPHENYLIMINO)DIETHANOL; 2,2'-(4-Aminophenylimino)diethanol; 2-[(4-aminophenyl)(2-hydroxyethyl)amino]ethan-1-ol; 2-[(4-Amino-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol; N,N-[bis-(2-hydroxyethyl)]-p-phenylenediamine |
| Molecular Formula | CH3C6H4N(CH2CH2OH)2 |
| Molecular Weight | 195.26 |
| Purity | ≥97.0 (NT) |
| Density | 1.244 g/cm3 |
| Boiling Point | 338-340 °C (lit.) |
| Melting Point | 49-53 °C (lit.) |
| Appearance | solid |
| Storage Condition | 2-8°C |
| EINECS | 221-359-1 |
| HTC | 2922199090 |
| PubChem ID | 57647227 |
| MDL Number | MFCD00020580 |
| SMILES | Cc1ccc(cc1)N(CCO)CCO |
| InChI | 1S/C11H17NO2/c1-10-2-4-11(5-3-10)12(6-8-13)7-9-14/h2-5,13-14H,6-9H2,1H3 |
| InChI Key | JUVSRZCUMWZBFK-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2099156 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/33806_1_7575_35_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| Tetrabutylammonium 4-toluenesulfonate | 7182-86-7 | 2A-9033474 |
| 2-Naphthaleneethanol | 7228-47-9 | 2A-9033502 |
| 2-Ethyl-1-hexanethiol | 7341-17-5 | 2A-9033570 |
| 2,3,4-Trichlorotoluene | 7359-72-0 | 2A-9033582 |
| 1,2-Cyclohexanedicarboximide | 7506-66-3 | 2A-9033761 |
| Aminoacetone hydrochloride | 7737-17-9 | 2A-9033969 |
| 2-Iodo-4-nitrotoluene | 7745-92-8 | 2A-9033974 |
| 4,4'-Disulfanediylbis(4,1-phenylene)dimethanol | 7748-20-1 | 2A-9033977 |
| Toluene ethylsulfonamide | 8047-99-2 | 2A-9034336 |
| Polyethyleneimine | 9002-98-6 | 2A-9034397 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA