CAS Number7318-00-5
SynonymsETHYL 3-AMINO-2-BUTENOATE; Ethyl 3-aminobut-2-enoate; MFCD00008073; Crotonic acid, 3-amino-, ethyl ester; EINECS 230-782-0; ETHYL B-IMINOBUTYRATE; ethyl (2Z)-3-aminobut-2-enoate; Ethyl β-aminocrotonate; ethyl 3-aminocrotonate; 3-Aminocrotonicacidethylester; 2-Butenoic acid, 3-amino-, ethyl ester; 3-Amino-2-butenoic acid ethyl; β-Aminocrotonic acid ethyl ester; Ethyl 3-Amino-2-butanol
Molecular FormulaCH3C(NH2)=CHCO2C2H5
Molecular Weight129.16
Purity98%
Density1.0±0.1 g/cm3
Boiling Point210-215 °C (lit.)
Melting Point33-35 °C (lit.)
AppearanceSlightly yellow low melting point solid or liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7318-00-5 |
| Catalog No. | 2A-9033550 |
| Chinese Name | 3-氨基巴豆酸乙酯 |
| Synonyms | ETHYL 3-AMINO-2-BUTENOATE; Ethyl 3-aminobut-2-enoate; MFCD00008073; Crotonic acid, 3-amino-, ethyl ester; EINECS 230-782-0; ETHYL B-IMINOBUTYRATE; ethyl (2Z)-3-aminobut-2-enoate; Ethyl β-aminocrotonate; ethyl 3-aminocrotonate; 3-Aminocrotonicacidethylester; 2-Butenoic acid, 3-amino-, ethyl ester; 3-Amino-2-butenoic acid ethyl; β-Aminocrotonic acid ethyl ester; Ethyl 3-Amino-2-butanol |
| Molecular Formula | CH3C(NH2)=CHCO2C2H5 |
| Molecular Weight | 129.16 |
| Purity | 98 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 210-215 °C (lit.) |
| Melting Point | 33-35 °C (lit.) |
| Appearance | Slightly yellow low melting point solid or liquid |
| Storage Condition | Sealed and stored in a cool, dry environment. |
| Packaging | I; II; III |
| PubChem ID | 24894385 |
| MDL Number | MFCD02730138 |
| SMILES | CCOC(=O)\C=C(\C)N |
| InChI | 1S/C6H11NO2/c1-3-9-6(8)4-5(2)7/h4H,3,7H2,1-2H3/b5-4- |
| InChI Key | YPMPTULBFPFSEQ-PLNGDYQASA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/33550_1_7318_00_5.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| beta-D-Glucopyranosylamine | 7284-37-9 | 2A-9033530 |
| Vegiben 2E | 7286-84-2 | 2A-9033531 |
| 4'-Bromovalerophenone | 7295-44-5 | 2A-9033534 |
| 4-Bromohexanophenone | 7295-46-7 | 2A-9033535 |
| 3,4-Dimethoxybenzyl chloride | 7306-46-9 | 2A-9033542 |
| 1-Methoxy-1-propene | 7319-16-6 | 2A-9033551 |
| Potassium pyrophosphate | 7320-34-5 | 2A-9033552 |
| 2-Bromoanthracene | 7321-27-9 | 2A-9033554 |
| L-Alaninamide | 7324-05-2 | 2A-9033557 |
| L-2-Aminobutanamide | 7324-11-0 | 2A-9033558 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS