
CAS Number7250-52-4
Synonyms4-Methyl-pyridin-carbonsaeure-(3)-amid; 4-Methyl-nicotinsaeure-amid; 4-methyl-nicotinamide; 4-methyl-nicotinic acid amide; 4-Methyl-3-pyridinecarboxamide
Molecular FormulaC7H8O1N2
Molecular Weight136.15
Purity98.00%
Density1.157 g/cm3
Boiling Point294.1ºC at 760 mmHg
Melting Point102-105ºC
AppearanceWhite to off-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7250-52-4 |
| Catalog No. | 2A-9033510 |
| Chinese Name | 4-甲基烟酰胺 |
| Synonyms | 4-Methyl-pyridin-carbonsaeure-(3)-amid; 4-Methyl-nicotinsaeure-amid; 4-methyl-nicotinamide; 4-methyl-nicotinic acid amide; 4-Methyl-3-pyridinecarboxamide |
| Molecular Formula | C7H8O1N2 |
| Molecular Weight | 136.15 |
| Purity | 98.00 |
| Density | 1.157 g/cm3 |
| Boiling Point | 294.1ºC at 760 mmHg |
| Melting Point | 102-105ºC |
| Appearance | White to off-white solid |
| Storage Condition | Room temperature, inert atmosphere |
| HTC | 2933399090 |
| MDL Number | MFCD00234322 |
| SMILES | Cc1ccncc1C(N)=O |
| InChI | InChI=1S/C7H8N2O/c1-5-2-3-9-4-6(5)7(8)10/h2-4H,1H3,(H2,8,10) |
| InChI Key | SXKLOQCGXUTBNP-UHFFFAOYSA-N |
| MSDS | msds/33510_1_7250_52_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Chlorophenyl ethyl sulfone | 7205-80-3 | 2A-9033482 |
| 2-Ethyl-2-phenylmalonamide | 7206-76-0 | 2A-9033488 |
| Zinc glycinate | 14281-83-5 | 2A-9033496 |
| 4-Hydroxybut-2-ynoic acid | 7218-52-2 | 2A-9033499 |
| Oxacillin sodium monohydrate | 7240-38-2 | 2A-9033508 |
| Dimethyl 3-hydroxyglutarate | 7250-55-7 | 2A-9033512 |
| Phenyl-(2-pyridyl)acetamide | 7251-52-7 | 2A-9033515 |
| 2-Methoxynicotinonitrile | 7254-34-4 | 2A-9033520 |
| 4,5-Dichloronaphthalene-1,8-dicarboxylic anhydride | 7267-14-3 | 2A-9033521 |
| 2,2'-Dipyridyl N,N'-dioxide | 7275-43-6 | 2A-9033524 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA