
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7147-90-2 |
| Catalog No. | 2A-9033429 |
| Chinese Name | 4-氯酞酰亚胺 |
| Synonyms | 4-chlorophthalimide; 5-Chloro-1H-isoindole-1,3(2H)-dione |
| Molecular Formula | C8H4ClNO2 |
| Molecular Weight | 181.576 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Appearance | Light yellow crystalline powder |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2925190090 |
| SMILES | O=C1NC(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-5-6(3-4)8(12)10-7(5)11/h1-3H,(H,10,11,12) |
| InChI Key | BGJNRQSGJHVURK-UHFFFAOYSA-N |
| MSDS | msds/33429_1_7147_90_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Diaminobenzene-1,4-disulphonic acid | 7139-89-1 | 2A-9033421 |
| Cholesteryl chloroformate | 7144-08-3 | 2A-9033424 |
| 2-Biphenylyl glycidyl ether | 7144-65-2 | 2A-9033425 |
| Methyl D-valinate hydrochloride | 7146-15-8 | 2A-9033426 |
| 4-Chloro-3-methyl-6-nitrophenol | 7147-89-9 | 2A-9033428 |
| 1-Pyrrolidino-1-cyclopentene | 7148-07-4 | 2A-9033431 |
| 2-Bromopropionyl chloride | 7148-74-5 | 2A-9033433 |
| Diethyl 3-oxoadipate | 7149-59-9 | 2A-9033439 |
| Ethyl L-pyroglutamate | 7149-65-7 | 2A-9033440 |
| 4-Chloro-3-methylaniline | 7149-75-9 | 2A-9033442 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA