
CAS Number7116-95-2
Synonyms4-(propan-2-yl)biphenyl; 4-Isopropylbiphenyl; 1-phenyl-4-propan-2-ylbenzene; EINECS 230-420-1; MFCD00221718; 4-(1-methylethyl)biphenyl
Molecular FormulaC15H16
Molecular Weight196.29
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point293.9±10.0 °C at 760 mmHg
Melting Point11°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7116-95-2 |
| Catalog No. | 2A-9033407 |
| Chinese Name | 4-异丙基联苯 |
| Synonyms | 4-(propan-2-yl)biphenyl; 4-Isopropylbiphenyl; 1-phenyl-4-propan-2-ylbenzene; EINECS 230-420-1; MFCD00221718; 4-(1-methylethyl)biphenyl |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 293.9±10.0 °C at 760 mmHg |
| Melting Point | 11°C |
| Storage Condition | For the packaging, storage and transportation meth |
| HTC | 2902909090 |
| MDL Number | MFCD00221718 |
| SMILES | CC(C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16/c1-12(2)13-8-10-15(11-9-13)14-6-4-3-5-7-14/h3-12H,1-2H3 |
| InChI Key | KWSHGRJUSUJPQD-UHFFFAOYSA-N |
| MSDS | msds/33407_1_7116_95_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethyldiselenide | 7101-31-7 | 2A-9033399 |
| 3-Bromoquinolin-6-amine | 7101-96-4 | 2A-9033400 |
| 3-Butenylmagnesium bromide | 7103-09-5 | 2A-9033401 |
| Levomepromazine maleate | 7104-38-3 | 2A-9033402 |
| Methyl Green zinc chloride salt | 7114-03-6 | 2A-9033404 |
| 4-Pentylbiphenyl | 7116-96-3 | 2A-9033408 |
| 4-Octylbiphenyl | 7116-97-4 | 2A-9033409 |
| 3-Bromo-2-nitroaniline | 7138-15-0 | 2A-9033419 |
| 4-Chloromandelic acid | 7138-34-3 | 2A-9033420 |
| 2,5-Diaminobenzene-1,4-disulphonic acid | 7139-89-1 | 2A-9033421 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA