
CAS Number6989-38-4
Synonyms1-[(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy]-3-methyl-3-buten-2-ol; (-)-1-(4,8-dimethoxy-furo[2,3-b]quinolin-7-yloxy)-3-methyl-but-3-en-2-ol; Evodine
Molecular FormulaC18H19NO5
Molecular Weight470.51
Purity>90 (HPLC)%
Density1.2±0.1 g/cm3
Boiling Point507.0±50.0 °C at 760 mmHg
Melting Point153-154ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6989-38-4 |
| Catalog No. | 2A-9033339 |
| Chinese Name | 吴茱萸内酯 |
| Synonyms | 1-[(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy]-3-methyl-3-buten-2-ol; (-)-1-(4,8-dimethoxy-furo[2,3-b]quinolin-7-yloxy)-3-methyl-but-3-en-2-ol; Evodine |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 470.51 |
| Purity | >90 (HPLC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 507.0±50.0 °C at 760 mmHg |
| Melting Point | 153-154ºC |
| Appearance | powder |
| Storage Condition | 2-8C |
| Application | Evodine is the main limonoid in Evodiae Fuctus and is a potent P-gp inhibitor. Evodine has a protective effect against glutamate-induced toxicity by preserving the antioxidant defense system. |
| PubChem ID | 24896458 |
| MDL Number | MFCD00075922 |
| SMILES | CC1(C)O[C@H]2CC(=O)OC[C@]23[C@H]4CC[C@@]5(C)[C@@H](OC(=O)[C@H]6O[C@@]56[C@]4(C)C(=O)C[C@@H]13)c7ccoc7 |
| InChI | 1S/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
| InChI Key | KBDSLGBFQAGHBE-MSGMIQHVSA-N |
| NACRES Code | NA.25 |
| UNSPSC | 12352205 |
| MSDS | msds/33339_1_6989_38_4.pdf |
| Transport Info | Product Name: Evodiacetone |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Amino-6-methylbenzenesulfonamide | 6973-09-7 | 2A-9033322 |
| 1-Cyclohexenylacetonitrile | 6975-71-9 | 2A-9033327 |
| 2-Methoxyethyl methacrylate | 6976-93-8 | 2A-9033329 |
| Kasugamycin | 6980-18-3 | 2A-9033333 |
| Bayogenin | 6989-24-8 | 2A-9033338 |
| 3,6-Diamino-2-picoline | 6992-84-3 | 2A-9033342 |
| Seleninobenzoic acid | 6996-92-5 | 2A-9033346 |
| (2-Chloroethyl)trimethylammonium | 7003-89-6 | 2A-9033348 |
| 2,7-Dichlorofluorene | 7012-16-0 | 2A-9033352 |
| Magnesium aspartate tetrahydrate | 7018-07-7 | 2A-9033356 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA