CAS Number6843-89-6
SynonymsNaphthoresorcin-carbonsaeure-(2)-ethylester; 1,3-Dihydroxy-2-naphthalenecarboxylic acid ethyl ester; ethyl 1,3-dihydroxy-2-naphthoate; 1,3-Dihydroxy-naphthalin-carbonsaeure-(2)-ethylester; 1,3-Dihydroxy-[2]naphthoesaeure-aethylester; ethyl 1,3-dihydroxynaphthoate; F0118-0027; 1,3-dihydroxy-[2]naphthoic acid ethyl ester; 1,3-dihydroxy-naphthalene-2-carboxylic acid ethyl ester
Molecular FormulaC13H12O4
Molecular Weight232.24
Purity98.00%
Density1.328g/cm3
Boiling Point375.5ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6843-89-6 |
| Catalog No. | 2A-9033180 |
| Chinese Name | 1,3-二羟基萘-2-甲酸乙酯 |
| Synonyms | Naphthoresorcin-carbonsaeure-(2)-ethylester; 1,3-Dihydroxy-2-naphthalenecarboxylic acid ethyl ester; ethyl 1,3-dihydroxy-2-naphthoate; 1,3-Dihydroxy-naphthalin-carbonsaeure-(2)-ethylester; 1,3-Dihydroxy-[2]naphthoesaeure-aethylester; ethyl 1,3-dihydroxynaphthoate; F0118-0027; 1,3-dihydroxy-[2]naphthoic acid ethyl ester; 1,3-dihydroxy-naphthalene-2-carboxylic acid ethyl ester |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 |
| Purity | 98.00 |
| Density | 1.328g/cm3 |
| Boiling Point | 375.5ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918290000 |
| MDL Number | MFCD00451682 |
| SMILES | CCOC(=O)c1c(O)cc2ccccc2c1O |
| InChI | InChI=1S/C13H12O4/c1-2-17-13(16)11-10(14)7-8-5-3-4-6-9(8)12(11)15/h3-7,14-15H,2H2,1H3 |
| InChI Key | JNVQTZHEEIATCI-UHFFFAOYSA-N |
| MSDS | msds/33180_1_6843_89_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Methylthiosemicarbazide | 6610-29-3 | 2A-9033011 |
| 4-(5-Chloromethyl-1,2,4-oxadiazol-3-yl)aniline | 6674-17-5 | 2A-9033082 |
| Cyclooctanecarbaldehyde | 6688-11-5 | 2A-9033092 |
| 5-Norbornene-2,2-dimethanol | 6707-12-6 | 2A-9033102 |
| trans-4-Ethylcyclohexanecarboxylic acid | 6833-47-2 | 2A-9033165 |
| 1,1-Cyclopropanedicarboxylic acid dimethyl ester | 6914-71-2 | 2A-9033227 |
| 1-(Aminocarbonyl)-1-cyclopropanecarboxylic acid | 6914-74-5 | 2A-9033228 |
| 1-Cyano-1-cyclopropanecarboxylic acid | 6914-79-0 | 2A-9033229 |
| Boc-Glycine hydrazide | 6926-09-6 | 2A-9033246 |
| 2-Methyl-3-thiosemicarbazide | 6938-68-7 | 2A-9033259 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS