
CAS Number6789-88-4
SynonymsMFCD00051714; EINECS 229-856-5; Hexyl benzoate; Benzoic acid, hexyl ester
Molecular FormulaC13H18O2
Molecular Weight206.28
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point286.7±8.0 °C at 760 mmHg
AppearanceTransparent colorless liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6789-88-4 |
| Catalog No. | 2A-9033141 |
| Chinese Name | 苯甲酸己酯 |
| Synonyms | MFCD00051714; EINECS 229-856-5; Hexyl benzoate; Benzoic acid, hexyl ester |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 286.7±8.0 °C at 760 mmHg |
| Appearance | Transparent colorless liquid |
| Storage Condition | room temperature, dry |
| HTC | 2916310090 |
| MDL Number | MFCD00051714 |
| SMILES | CCCCCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-2-3-4-8-11-15-13(14)12-9-6-5-7-10-12/h5-7,9-10H,2-4,8,11H2,1H3 |
| InChI Key | UUGLJVMIFJNVFH-UHFFFAOYSA-N |
| Hazard Symbols | 8.0 |
| MSDS | msds/33141_1_6789_88_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Ethoxyphenylacetonitrile | 6775-77-5 | 2A-9033130 |
| 1-Benzyl hydantoin | 6777-05-5 | 2A-9033132 |
| Phthalylglycyl chloride | 6780-38-7 | 2A-9033134 |
| Ethyl N-phenylformimidate | 6780-49-0 | 2A-9033135 |
| Limonenal | 6784-13-0 | 2A-9033137 |
| Dodecaethylene glycol | 6790-09-6 | 2A-9033142 |
| Ambroxane | 6790-58-5 | 2A-9033143 |
| 1-Benzocyclobutenecarbonitrile | 6809-91-2 | 2A-9033154 |
| Sodium propanolate | 6819-41-6 | 2A-9033158 |
| Maltoryzine | 6826-42-2 | 2A-9033160 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA