
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6304-24-1 |
| Catalog No. | 2A-9003307 |
| Chinese Name | 2-异丁基吡啶 |
| Synonyms | EINECS 228-606-2; 2-(2-Methylpropyl)pyridine; MFCD02262142 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 |
| Purity | 99 |
| Density | 0.899 |
| Boiling Point | 182.4ºC at 760 mmHg |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| HTC | 2933399090 |
| MDL Number | C9H13N |
| SMILES | CC(C)Cc1ccccn1 |
| InChI | InChI=1S/C9H13N/c1-8(2)7-9-5-3-4-6-10-9/h3-6,8H,7H2,1-2H3 |
| InChI Key | BBVSPSDWPYWMOR-UHFFFAOYSA-N |
| MSDS | msds/3307_1_6304_24_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Hydroxymethyl-3-methyl-4-nitropyridine | 168167-49-5 | 2A-9003282 |
| 2-Hydroxymethylpiperidine | 3433-37-2 | 2A-9003283 |
| 2-Hydroxypyridine | 142-08-5 | 2A-9003286 |
| 2-Hydroxyquinoline-4-carboxylic acid | 15733-89-8 | 2A-9003287 |
| 2-Iodothiophene | 3437-95-4 | 2A-9003305 |
| 2-Isobutylquinoline | 93-19-6 | 2A-9003308 |
| 2-Isopropyl-4-(methylaminomethyl)thiazole | 154212-60-9 | 2A-9003309 |
| 2-Isopropyl-4-methylthiazole | 15679-13-7 | 2A-9003310 |
| 2-Mercapto-4-methylpyrimidine | 6959-66-6 | 2A-9003316 |
| 2-Mercapto-5-chlorobenzoxazole | 5331-91-9 | 2A-9003317 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA