
CAS Number6581-06-2
Synonymsea2277; Ro 2-330; ro2-3308; CS 4030; 3-Benziloyloxyquinuclidine; 3-Chinuclidylbenzilate; (±)-3-quinuclidinyl benzilate; 1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2,2-diphenylacetate; quinuclidinyl benzilate
Molecular FormulaC21H23NO3
Molecular Weight337.41200
Purity98.00%
Density1.25g/cm3
Boiling Point439ºC at 760 mmHg
Melting Point164ºC
Appearancepowder | white
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6581-06-2 |
| Catalog No. | 2A-9032995 |
| Chinese Name | 二苯乙醇酸-3-奎宁环酯 |
| Synonyms | ea2277; Ro 2-330; ro2-3308; CS 4030; 3-Benziloyloxyquinuclidine; 3-Chinuclidylbenzilate; (±)-3-quinuclidinyl benzilate; 1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2,2-diphenylacetate; quinuclidinyl benzilate |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.41200 |
| Purity | 98.00 |
| Density | 1.25g/cm3 |
| Boiling Point | 439ºC at 760 mmHg |
| Melting Point | 164ºC |
| Appearance | powder | white |
| Water Solubility | chloroform: but decomposes within 24 hrssoluble |
| Storage Condition | The warehouse is low-temperature, ventilated, dry, |
| HTC | 2933391000 |
| SMILES | O=C(OC1CN2CCC1CC2)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c23-20(25-19-15-22-13-11-16(19)12-14-22)21(24,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-10,16,19,24H,11-15H2 |
| InChI Key | HGMITUYOCPPQLE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | 2. Import license for dual-use items and technologies 3. Export license for dual-use items and technologies |
| Transport Info | Product name: Supervision conditions 2. Import license for dual-use items and technologies 3. Export license for dual-use items and technologies |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclopropylacetonitrile | 6542-60-5 | 2A-9032971 |
| 2,4,6-Trichlorobenzonitrile | 6575-05-9 | 2A-9032986 |
| 2-Amino-6-chlorobenzonitrile | 147249-41-0 | 2A-9032988 |
| 1-(4-Fluorophenyl)-2-(pyridin-4-yl)ethanone | 6576-05-2 | 2A-9032991 |
| Oxapium iodide | 6577-41-9 | 2A-9032992 |
| Methyl 2-cyanobenzoate | 6587-24-2 | 2A-9032998 |
| N-(2,6-Dichlorophenyl)thiourea | 6590-91-6 | 2A-9032999 |
| BARIUM FERRITE | 11138-11-7 | 2A-9033001 |
| 2-Chloro-1,3,2-dioxaphospholane-2-oxide | 6609-64-9 | 2A-0200202 |
| 3,5-Dimethylbenzoyl chloride | 6613-44-1 | 2A-9033012 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA