
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6373-46-2 |
| Catalog No. | 2A-9032822 |
| Chinese Name | 4-苄氧基苯胺 |
| Synonyms | 4-phenylmethoxyaniline; 4-(Benzyloxy)aniline; p-Benzyloxyaniline |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.248 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 357.7±17.0 °C at 760 mmHg |
| Melting Point | 54-55°C |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| SMILES | Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H13NO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| InChI Key | FIIDVVUUWRJXLF-UHFFFAOYSA-N |
| MSDS | msds/32822_1_6373_46_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| D-(+)-Maltose monohydrate | 6363-53-7 | 2A-9032812 |
| S-2-Hydroxyethyl-L-cysteine | 6367-98-2 | 2A-9032814 |
| Vat Green 9 | 6369-65-9 | 2A-9032816 |
| Cyclohexyldiphenylphosphine | 6372-42-5 | 2A-9032820 |
| Aceanthrenequinone | 6373-11-1 | 2A-9032821 |
| 5-Amino-2-ethoxy-benzenesulfonic acid | 6375-02-6 | 2A-9032826 |
| 2-Acetamido-4-methylphenol | 6375-17-3 | 2A-9032827 |
| 3-(N,N-Diethylamino)acetanilide | 6375-46-8 | 2A-9032829 |
| 3'-Amino-4'-methoxyacetanilide | 6375-47-9 | 2A-9032830 |
| 4-Chloro-2-methoxy-5-methylaniline | 6376-14-3 | 2A-9032832 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA