
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6305-95-9 |
| Catalog No. | 2A-9032712 |
| Chinese Name | 2-氯苯基丙酮 |
| Synonyms | 2-chlorophenylacetone; MFCD00045175 |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 168.62000 |
| Purity | 98.00 |
| Density | 1.14g/cm3 |
| Boiling Point | 102-103°C 3mm |
| Appearance | Transparent slightly yellow liquid |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2914700090 |
| SMILES | CC(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C9H9ClO/c1-7(11)6-8-4-2-3-5-9(8)10/h2-5H,6H2,1H3 |
| InChI Key | LWGNDIMNCPMZOF-UHFFFAOYSA-N |
| MSDS | msds/32712_1_6305_95_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 1,6-Diacetoxyhexane | 6222-17-9 | 2A-9032598 |
| 2-Amino-4-chlorotoluene hydrochloride | 6259-42-3 | 2A-9032633 |
| Phenylpyridin-3-ylmethanol | 6270-47-9 | 2A-9032646 |
| 1-Bromo-6-chlorohexane | 6294-17-3 | 2A-9032688 |
| 1-(4-Pyridyl)acetone | 6304-16-1 | 2A-9032707 |
| 4-(TRIFLUOROACETYL)TOLUENE | 394-59-2 | 2A-9032724 |
| 5-Chloro-6-(4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)toluene-3-sulphonic acid | 6387-17-3 | 2A-9032844 |
| 1,6-Hexanediol dimethacrylate | 6606-59-3 | 2A-9033007 |
| Sodium 4-amino-6-chlorotoluene-3-sulphonate | 6627-59-4 | 2A-9033032 |
| 2-[(Pyridin-2-ylmethyl)amino]ethanol | 6636-71-1 | 2A-9033054 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA