| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6283-74-5 |
| Catalog No. | 2A-9032665 |
| Chinese Name | 二-O-乙酰基-L-酒石酸酐 |
| Synonyms | Tartaric anhydride, diacetate; MFCD00037918; EINECS 228-502-7 |
| Molecular Formula | C8H8O7 |
| Molecular Weight | 216.14 |
| Purity | 97 |
| Density | 1.43g/cm3 |
| Boiling Point | 350.6ºC at 760 mmHg |
| Melting Point | 130-135 °C (lit.) |
| Appearance | white crystal or needle |
| Water Solubility | Soluble in: methanol |
| Storage Condition | -20℃ in a cool and dry place, sealed and stored |
| EINECS | 228-502-7 |
| HTC | 2918300090 |
| PubChem ID | 24862037 |
| MDL Number | MFCD00037918 |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)C(=O)OC1=O |
| InChI | 1S/C8H8O7/c1-3(9)13-5-6(14-4(2)10)8(12)15-7(5)11/h5-6H,1-2H3/t5-,6-/m1/s1 |
| InChI Key | XAKITKDHDMPGPW-PHDIDXHHSA-N |
| Beilstein/REAXYS | 87315 |
| NACRES Code | NA.22 |
| UNSPSC | 12352005 |
| MSDS | msds/32665_1_6283_74_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Propoxyphenol | 6280-96-2 | 2A-9032657 |
| 3-(5-Nitro-2-furyl)acrylic acid | 6281-23-8 | 2A-9032658 |
| N-(Hydroxymethyl)benzamide | 6282-02-6 | 2A-9032660 |
| 2-Chloro-5-nitroaniline | 6283-25-6 | 2A-9032662 |
| 2-Cyanosuccinic acid dimethyl ester | 6283-71-2 | 2A-9032664 |
| Ethyl 3-oxo-3-(3-pyridyl)propionate | 6283-81-4 | 2A-9032666 |
| N-Methyl-D-glucamine | 6284-40-8 | 2A-9032667 |
| Fluorene-9-acetic acid | 6284-80-6 | 2A-9032669 |
| 3-Ethyl-1-pentyn-3-ol | 6285-06-9 | 2A-9032671 |
| Ethyl 3-anilinobut-2-enoate | 6287-35-0 | 2A-9032675 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS