
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6268-43-5 |
| Catalog No. | 2A-9032643 |
| Chinese Name | 1,3-二吡啶-2-基脲 |
| Synonyms | N,N'-di-2-pyridylurea; 1,3-di-2-pyridylurea; N,N'-dipyridin-2-ylurea |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.22300 |
| Purity | 98.00 |
| Density | 1.37g/cm3 |
| Boiling Point | 299.3ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933399090 |
| SMILES | O=C(Nc1ccccn1)Nc1ccccn1 |
| InChI | InChI=1S/C11H10N4O/c16-11(14-9-5-1-3-7-12-9)15-10-6-2-4-8-13-10/h1-8H,(H2,12,13,14,15,16) |
| InChI Key | FOQXHWCMYZXOGZ-UHFFFAOYSA-N |
| MSDS | msds/32643_1_6268_43_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Isopropylthiophenol | 6262-87-9 | 2A-9032638 |
| 1,3-Dibenzoylpropane | 6263-83-8 | 2A-9032639 |
| m-(o-Toluidino)phenol | 6264-98-8 | 2A-9032640 |
| 2-Amino-4-methyl-6-nitrophenol | 6265-07-2 | 2A-9032641 |
| 4-Bromo-3,5-dimethylanisole | 6267-34-1 | 2A-9032642 |
| 2-Methyl-5-nitrobenzenesulfonamide | 6269-91-6 | 2A-9032645 |
| 6-Chloronicotinamide | 6271-78-9 | 2A-9032648 |
| 2-Benzyloxyphenol | 6272-38-4 | 2A-9032650 |
| 4-Amino-N-methylbenzamide | 6274-22-2 | 2A-9032651 |
| 3-Chloropropylamine hydrochloride | 6276-54-6 | 2A-9032652 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA