
CAS Number6245-57-4
Synonyms2-Methyl-p-anisic acid; 2-methyl-4-methoxybenzoic acid; 4-Methoxy-2-methyl-benzoesaeure; MFCD00020291; 4-Methoxy-2-methylbenzoic acid; 2-Methyl-4-methoxybenzoesaeure; 4-methoxy-2-methyl benzoic acid
Molecular FormulaCH3OC6H3(CH3)B(OH)2
Molecular Weight165.98
Purity≥95%
Density1.2±0.1 g/cm3
Boiling Point294.3±20.0 °C at 760 mmHg
Melting Point169-174 °C (lit.)
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6245-57-4 |
| Catalog No. | 2A-9032624 |
| Chinese Name | 4-甲氧基-3-甲基苯甲酸 |
| Synonyms | 2-Methyl-p-anisic acid; 2-methyl-4-methoxybenzoic acid; 4-Methoxy-2-methyl-benzoesaeure; MFCD00020291; 4-Methoxy-2-methylbenzoic acid; 2-Methyl-4-methoxybenzoesaeure; 4-methoxy-2-methyl benzoic acid |
| Molecular Formula | CH3OC6H3(CH3)B(OH)2 |
| Molecular Weight | 165.98 |
| Purity | ≥95 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 294.3±20.0 °C at 760 mmHg |
| Melting Point | 169-174 °C (lit.) |
| Appearance | powder |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2918990090 |
| PubChem ID | 24883021 |
| MDL Number | MFCD02684315 |
| SMILES | COc1ccc(B(O)O)c(C)c1 |
| InChI | 1S/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
| InChI Key | AMSQNQJCBXQYEX-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352103 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Mordant Yellow 26 | 6232-49-1 | 2A-9032612 |
| Disperse Orange 5 | 6232-56-0 | 2A-9032613 |
| 3-Quinuclidinol hydrochloride | 6238-13-7 | 2A-9032616 |
| 3-Aminoquinuclidine | 6238-14-8 | 2A-9032617 |
| 1-Amino-3-hydroxyadamantane hydrochloride | 6240-03-5 | 2A-9032619 |
| 3-Oxours-12-en-28-oic acid | 6246-46-4 | 2A-9032625 |
| (3-Carboxypropyl)trimethylammonium chloride | 6249-56-5 | 2A-9032627 |
| Disperse Orange 13 | 6253-10-7 | 2A-9032628 |
| 3-Phenyl-L-serine | 6254-48-4 | 2A-9032629 |
| 4-Hydroxy-6-methylamino-2-naphthalene sulfonic acid | 6259-53-6 | 2A-9032634 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA