
CAS Number6217-68-1
Synonymspotassium 4-nitrophenylsulfate monoester; potassum p-nitrophenyl sulfate; EINECS 228-288-5; Sulfuric acid 4-nitrophenyl ester; Potassium 4-nitrophenyl sulfate; p-NITROPHENYL SULFATE; potassium 4-nitrobenzenesulfonate; 4-NITROPHENYL SULFATE; p-nitrophenyl potassium sulphate; potassium p-nitrophenylsulfonate; POTASSIUM P-NITROPHENYL SULPHATE; Sulfuric acid p-nitrophenyl ester; potassium p-nitrophenyl sulfate; nitrophenyl sulphate; P-NITROPHENYL SULFATE POTASSIUM; Sulfuric acid, 4-nitrophenyl ester, potassium salt (1:1); potassium 4-nitrophenyl sulphate; MFCD00007466
Molecular FormulaNO2C6H4OSO2OK
Molecular Weight257.26
Purity≥98 (TLC)%
Melting Point246-250 °C (lit.)
Appearancepowder
EINECS228-288-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6217-68-1 |
| Catalog No. | 2A-9032594 |
| Chinese Name | 4-硝基苯硫酸钾 |
| Synonyms | potassium 4-nitrophenylsulfate monoester; potassum p-nitrophenyl sulfate; EINECS 228-288-5; Sulfuric acid 4-nitrophenyl ester; Potassium 4-nitrophenyl sulfate; p-NITROPHENYL SULFATE; potassium 4-nitrobenzenesulfonate; 4-NITROPHENYL SULFATE; p-nitrophenyl potassium sulphate; potassium p-nitrophenylsulfonate; POTASSIUM P-NITROPHENYL SULPHATE; Sulfuric acid p-nitrophenyl ester; potassium p-nitrophenyl sulfate; nitrophenyl sulphate; P-NITROPHENYL SULFATE POTASSIUM; Sulfuric acid, 4-nitrophenyl ester, potassium salt (1:1); potassium 4-nitrophenyl sulphate; MFCD00007466 |
| Molecular Formula | NO2C6H4OSO2OK |
| Molecular Weight | 257.26 |
| Purity | ≥98 (TLC) |
| Melting Point | 246-250 °C (lit.) |
| Appearance | powder |
| Storage Condition | -20℃ Avoid light, keep in a cool and dry place, se |
| EINECS | 228-288-5 |
| HTC | 2920909090 |
| PubChem ID | 24897664 |
| MDL Number | MFCD00007466 |
| SMILES | [K+].[O-][N+](=O)c1ccc(OS([O-])(=O)=O)cc1 |
| InChI | 1S/C6H5NO6S.K/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;/h1-4H,(H,10,11,12);/q;+1/p-1 |
| InChI Key | BITVAZYUWRLLCN-UHFFFAOYSA-M |
| Beilstein/REAXYS | 3786392 |
| NACRES Code | NA.32 |
| UNSPSC | 12352204 |
| MSDS | msds/32594_1_6217_68_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Octocrilene | 6197-30-4 | 2A-9032576 |
| Cucurbitacin B | 6199-67-3 | 2A-9032577 |
| Sulfacetamide sodium | 6209-17-2 | 2A-9032587 |
| Methyl 4-nitrobenzenesulfonate | 6214-20-6 | 2A-9032589 |
| 4-Butoxybenzyl alcohol | 6214-45-5 | 2A-9032590 |
| 2-Chlorobenzene-1,4-diammonium sulphate | 6219-71-2 | 2A-9032596 |
| 4-Amino-N,N-dimethylaniline sulfate | 6219-73-4 | 2A-9032597 |
| Mordant Green 28 | 6222-44-2 | 2A-9032599 |
| Sodium gualenate | 6223-35-4 | 2A-9032600 |
| Tris(3-methylphenyl)phosphine | 6224-63-1 | 2A-9032602 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA