
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6124-79-4 |
| Catalog No. | 2A-9032496 |
| Chinese Name | 4-甲基-2(5H)-呋喃酮 |
| Synonyms | 4-Methyl-5H-furan-2-one; 3-methyl-2-buten-4-olide |
| Molecular Formula | C5H6O2 |
| Molecular Weight | 98.1 |
| Purity | 98.00 |
| Density | 1.12 g/cm3 |
| Boiling Point | 222.4ºC at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | room temperature, dry |
| HTC | 2932209090 |
| MDL Number | MFCD00191546 |
| SMILES | CC1=CC(=O)OC1 |
| InChI | InChI=1S/C5H6O2/c1-4-2-5(6)7-3-4/h2H,3H2,1H3 |
| InChI Key | ZZEYQBNQZKUWKY-UHFFFAOYSA-N |
| MSDS | msds/32496_1_6124_79_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(2-Bromoethyl)-2-methyl-5-nitroimidazole | 6058-57-7 | 2A-9032447 |
| 4,5,6,7-Tetrahydro-1H-indazole-3-carboxylic acid | 6076-13-7 | 2A-9032457 |
| 3,4,6-Trichloropyridazine | 6082-66-2 | 2A-9032461 |
| 1-Methyl-1H-1,2,4-triazole | 6086-21-1 | 2A-9032464 |
| Piperidine hydrochloride | 6091-44-7 | 2A-9032467 |
| 3-Amino-5-hydroxypyrazole | 6126-22-3 | 2A-9032497 |
| 2-Chloroquinazoline | 6141-13-5 | 2A-9032510 |
| 1,1'-Thiocarbonyldiimidazole | 6160-65-2 | 2A-9032544 |
| Methyl pyrazine-2-carboxylate | 6164-79-0 | 2A-9032550 |
| Pyridazine hydrochloride | 6164-80-3 | 2A-9032551 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA