
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6097-32-1 |
| Catalog No. | 2A-9032472 |
| Chinese Name | 3',4'-二氯苯丙酮 |
| Synonyms | 1-(3,4-dichlorophenyl)propan-2-one; 1-(3,4-Dichlorophenyl)acetone |
| Molecular Formula | C9H8Cl2O |
| Molecular Weight | 203.065 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 271.3±25.0 °C at 760 mmHg |
| Appearance | Transparent light yellow liquid |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2914700090 |
| SMILES | CC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2O/c1-6(12)4-7-2-3-8(10)9(11)5-7/h2-3,5H,4H2,1H3 |
| InChI Key | AJUAASWQUWIMHM-UHFFFAOYSA-N |
| MSDS | msds/32472_1_6097_32_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Industrial Applications | ||
|---|---|---|
| 4-Chlorophenylacetone | 5586-88-9 | 2A-9031997 |
| 1,1-Cyclopentanedimethanol | 5763-53-1 | 2A-9032153 |
| Methoxyacetone | 5878-19-3 | 2A-9032240 |
| 2-Dimethylaminoethanol (+)-bitartrate salt | 5988-51-2 | 2A-9032378 |
| [3-[(Benzyl)oxy]-2-pyridinyl]methanol | 6059-29-6 | 2A-9032448 |
| Propargyl p-toluenesulfonate | 6165-76-0 | 2A-9032555 |
| 4-Bromophenylacetone | 6186-22-7 | 2A-9032566 |
| p-Toluenesulfonic acid monohydrate | 6192-52-5 | 2A-9032573 |
| 1,6-Diacetoxyhexane | 6222-17-9 | 2A-9032598 |
| 2-Amino-4-chlorotoluene hydrochloride | 6259-42-3 | 2A-9032633 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA