
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5703-26-4 |
| Catalog No. | 2A-9032081 |
| Chinese Name | 4-甲氧基苯乙醛 |
| Synonyms | (4-Methoxyphenyl)acetaldehyde; 2-(4-methoxyphenyl)acetaldehyde |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 255.5±0.0 °C at 760 mmHg |
| Melting Point | 0°C |
| Appearance | Light yellow transparent liquid |
| Storage Condition | -20°C, inert gas atmosphere |
| HTC | 2912499000 |
| MDL Number | MFCD27958453 |
| SMILES | COc1ccc(CC=O)cc1 |
| InChI | InChI=1S/C9H10O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,7H,6H2,1H3 |
| InChI Key | NRIVMXXOUOBRAG-UHFFFAOYSA-N |
| MSDS | msds/32081_1_5703_26_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Bromo-2-nitrobenzaldehyde | 5551-12-2 | 2A-9031966 |
| 2-Aminophenylboronic acid | 5570-18-3 | 2A-9031975 |
| 2-Nitrophenylboronic acid | 5570-19-4 | 2A-9031976 |
| (2-Amino-5-chlorobenzoyl)hydrazide | 5584-15-6 | 2A-9031992 |
| 2,3-Dimethoxy-5-methylbenzaldehyde | 5701-86-0 | 2A-9032080 |
| 2-Methoxyphenylboronic acid | 5720-06-9 | 2A-9032095 |
| 3'-Methylbiphenyl-4-carboxylic acid | 5728-33-6 | 2A-9032104 |
| Methyl 4'-nitro[1,1'-biphenyl]-4-carboxylate | 5730-75-6 | 2A-9032107 |
| 4'-Bromo[1,1'-biphenyl]-4-carboxylic acid | 5731-11-3 | 2A-9032109 |
| 4'-tert-Butyl[1,1'-biphenyl]-4-carboxylic acid | 5748-42-5 | 2A-9032138 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA