
CAS Number5635-67-6
SynonymsN-(3,4-dichlorobenzyl)-N-methylamine; MFCD0001362; 2-(3,4-dichlorophenyl)ethan-1-amine; 1-(3,4-Dichlorophenyl)-N-methylmethanamine; 2-(3,4-Dichlorophenyl)ethanamine
Molecular FormulaC8H9Cl2N
Molecular Weight190.074
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point242.8±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5635-67-6 |
| Catalog No. | 2A-9032034 |
| Chinese Name | N-(3,4-二氯苄基)-N-甲胺 |
| Synonyms | N-(3,4-dichlorobenzyl)-N-methylamine; MFCD0001362; 2-(3,4-dichlorophenyl)ethan-1-amine; 1-(3,4-Dichlorophenyl)-N-methylmethanamine; 2-(3,4-Dichlorophenyl)ethanamine |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.074 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 242.8±25.0 °C at 760 mmHg |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2921499090 |
| MDL Number | MFCD00013624 |
| SMILES | CNCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H9Cl2N/c1-11-5-6-2-3-7(9)8(10)4-6/h2-4,11H,5H2,1H3 |
| InChI Key | XOEHPEYVNJXYEN-UHFFFAOYSA-N |
| MSDS | msds/32034_1_5635_67_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Piperazin-2-one | 5625-67-2 | 2A-9032025 |
| N,N'-Dimorpholinomethane | 5625-90-1 | 2A-9032026 |
| Nortropan-3-one | 5632-84-8 | 2A-9032030 |
| 4-Hydroxyphenyl phenyl sulfide | 5633-55-6 | 2A-9032032 |
| Ambuphylline | 5634-34-4 | 2A-9032033 |
| N-(4-Cyanophenyl)guanidine | 5637-42-3 | 2A-9032035 |
| 5,6-Dihydrocyclopenta[b]thiophen-4-one | 5650-51-1 | 2A-9032036 |
| 4,5-Dihydrocyclopenta[b]thiophen-6-one | 5650-52-2 | 2A-9032037 |
| Phenyl propargyl sulfide | 5651-88-7 | 2A-9032038 |
| 2-Amino-4,5-dimethoxybenzoic acid | 5653-40-7 | 2A-9032040 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA