
CAS Number5609-91-6
SynonymsX-GLCNAC; 5-bromo-4-chloro-3-indolyl-N-acetyl-B-D-glucosaminide; MFCD00798384; 5-Bromo-4-chloro-1H-indol-3-yl 2-acetamido-2-deoxy-β-D-glucopyranoside; X-N-ACETYL-GLUCOSAMINIDE; X-GLUNAC
Molecular FormulaC16H18BrClN2O6
Molecular Weight449.681
Purity98.00%
Density1.8±0.1 g/cm3
Boiling Point752.2±60.0 °C at 760 mmHg
Melting Point240ºC(lit.)
AppearanceSlightly off-white to off-white crystalline powder (or colorless crystal)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5609-91-6 |
| Catalog No. | 2A-9032012 |
| Chinese Name | 5-溴-4-氯-3-吲哚-N-乙酰-β-D-氨基葡萄糖苷 |
| Synonyms | X-GLCNAC; 5-bromo-4-chloro-3-indolyl-N-acetyl-B-D-glucosaminide; MFCD00798384; 5-Bromo-4-chloro-1H-indol-3-yl 2-acetamido-2-deoxy-β-D-glucopyranoside; X-N-ACETYL-GLUCOSAMINIDE; X-GLUNAC |
| Molecular Formula | C16H18BrClN2O6 |
| Molecular Weight | 449.681 |
| Purity | 98.00 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 752.2±60.0 °C at 760 mmHg |
| Melting Point | 240ºC(lit.) |
| Appearance | Slightly off-white to off-white crystalline powder (or colorless crystal) |
| Water Solubility | DMF: soluble |
| Storage Condition | Store airtight in a cool, dry warehouse. Refrigera |
| HTC | 29389090 |
| SMILES | CC(=O)NC1C(Oc2c[nH]c3cc(Cl)c(Br)cc23)OC(CO)C(O)C1O |
| InChI | InChI=1S/C16H18BrClN2O6/c1-6(22)20-13-15(24)14(23)12(5-21)26-16(13)25-11-4-19-10-3-9(18)8(17)2-7(10)11/h2-4,12-16,19,21,23-24H,5H2,1H3,(H,20,22)/t12-,13-,14-,15-,16-/m1/s1 |
| InChI Key | GJFJDKFSKAEJGX-OXGONZEZSA-N |
| Transport Info | Product name: 5-bromo-4-chloro-3-indole-N-acetyl-β-D-glucosamine |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-N-4-Benzyl-2-phenylpiperazine | 5368-32-1 | 2A-9031714 |
| 4-Methoxyphenyl isocyanate | 5416-93-3 | 2A-9031783 |
| 4-Hydroxy-1,5-naphthyridine | 5423-54-1 | 2A-9031799 |
| 3-endo-8-Methyl-8-azabicyclo[3.2.1]octan-3-amine dihydrochloride | 5424-16-8 | 2A-9031802 |
| 2-Trichloromethyl-4(3H)-quinazolinone | 5558-95-2 | 2A-9031971 |
| 3-Oxabicyclo[3.1.0]hexane-2,4-dione | 5617-74-3 | 2A-9032018 |
| 3-Methyl-7-azaindole | 5654-93-3 | 2A-9032043 |
| (S)-(-)-3-Cyclohexenecarboxylic acid | 5708-19-0 | 2A-9032086 |
| (R)-3-Cyclohexenecarboxylic acid | 5709-98-8 | 2A-9032087 |
| 3-(2-Pyrrolidinyl)pyridine | 5746-86-1 | 2A-9032136 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA