
CAS Number5466-06-8
SynonymsEthyl 3-sulfanylpropanoate; EINECS 226-771-5; Propionic acid, 3-mercapto-, ethyl ester; MFCD00004896; Propanoic acid, 3-mercapto-, ethyl ester
Molecular FormulaC5H10O2S1
Molecular Weight134.2
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point194.3±0.0 °C at 760 mmHg
AppearanceColorless liquid with an unpleasant odor
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5466-06-8 |
| Catalog No. | 2A-9031883 |
| Chinese Name | 3-巯基丙酸乙酯 |
| Synonyms | Ethyl 3-sulfanylpropanoate; EINECS 226-771-5; Propionic acid, 3-mercapto-, ethyl ester; MFCD00004896; Propanoic acid, 3-mercapto-, ethyl ester |
| Molecular Formula | C5H10O2S1 |
| Molecular Weight | 134.2 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 194.3±0.0 °C at 760 mmHg |
| Appearance | Colorless liquid with an unpleasant odor |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2930909090 |
| MDL Number | MFCD00004896 |
| SMILES | CCOC(=O)CCS |
| InChI | InChI=1S/C5H10O2S/c1-2-7-5(6)3-4-8/h8H,2-4H2,1H3 |
| InChI Key | CJQWLNNCQIHKHP-UHFFFAOYSA-N |
| MSDS | msds/31883_1_5466_06_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Ethylcyclohexylamine | 5459-93-8 | 2A-9031866 |
| 2-Nitrophenylpyruvic acid | 5461-32-5 | 2A-9031869 |
| 4-Cyanophenylacetic acid | 5462-71-5 | 2A-9031870 |
| 3-Acetamido-5-nitrobenzoic acid | 5464-58-4 | 2A-9031873 |
| 2-Phenyl-2-ethylbutyric acid | 5465-28-1 | 2A-9031877 |
| Aminoacetonitrile sulfate | 5466-22-8 | 2A-9031884 |
| 2H-1,4-Benzoxazin-3(4H)-one | 5466-88-6 | 2A-9031887 |
| 1-Bromo-4-methoxynaphthalene | 5467-58-3 | 2A-9031889 |
| 2-Aminoacetophenone hydrochloride | 5468-37-1 | 2A-9031893 |
| 1-(4-Chlorophenyl)-2-methyl-2-propanol | 5468-97-3 | 2A-9031896 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA