
CAS Number5447-38-1
Synonyms4-O-acetylhomovanillic acid; 4-acetoxy-3-methoxyphenylacetic acid; acetylhomovanillic acid; 4-acetylhomovanilic acid
Molecular FormulaC11H12O5
Molecular Weight184.16
Purity≥99 (HPLC)%
Density1.256g/cm3
Boiling Point349.2ºC at 760mmHg
Melting Point138-140ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5447-38-1 |
| Catalog No. | 2A-9031850 |
| Chinese Name | 4-乙酰基-3-甲氧基苯乙酸 |
| Synonyms | 4-O-acetylhomovanillic acid; 4-acetoxy-3-methoxyphenylacetic acid; acetylhomovanillic acid; 4-acetylhomovanilic acid |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 184.16 |
| Purity | ≥99 (HPLC) |
| Density | 1.256g/cm3 |
| Boiling Point | 349.2ºC at 760mmHg |
| Melting Point | 138-140ºC |
| Appearance | powder |
| HTC | 2918990090 |
| MDL Number | MFCD00060353 |
| SMILES | Fc1c(ccc(c1)CC(=O)[O-])OC |
| InChI | 1S/C9H9FO3/c1-13-8-3-2-6(4-7(8)10)5-9(11)12/h2-4H,5H2,1H3,(H,11,12)/p-1 |
| InChI Key | VURNBRZIFABCRU-UHFFFAOYSA-M |
| NACRES Code | NA.22 |
| UNSPSC | 12352106 |
| MSDS | msds/31850_1_5447_38_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Ethylcyclohexanone | 5441-51-0 | 2A-9031835 |
| Norcantharidin | 5442-12-6 | 2A-9031836 |
| Methyl 2-bromopropionate | 5445-17-0 | 2A-9031841 |
| Methyl 2-bromohexanoate | 5445-19-2 | 2A-9031842 |
| Ethyl 2-bromooctanoate | 5445-29-4 | 2A-9031844 |
| 10,10-Dimethylanthrone | 5447-86-9 | 2A-9031851 |
| Cyclooctylamine | 5452-37-9 | 2A-9031855 |
| Methyl 5-bromovalerate | 5454-83-1 | 2A-9031859 |
| trans-2-Aminocyclohexanol hydrochloride | 5456-63-3 | 2A-9031861 |
| 2-Iodo-5-nitroaniline | 5459-50-7 | 2A-9031863 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA