
CAS Number2557-78-0
Synonyms2-fluorobenzenothiol; o-fluorobenzenethiol; 2-Fluorophenyl mercaptan; MFCD00041419; ortho-fluorobenzenethiol; 2-Fluorobenzenethiol; 2-Fluorothiophenol; o-Fluorothiophenol; 2-fluorobenzene thiol; 2-Mercaptofluorobenzene; 2-Fluoro thiophenol
Molecular FormulaC6H5FS
Molecular Weight128.167
Purity98%
Density1.2±0.1 g/cm3
Boiling Point162.7±13.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2557-78-0 |
| Catalog No. | 2A-9003183 |
| Chinese Name | 2-氟苯硫酚 |
| Synonyms | 2-fluorobenzenothiol; o-fluorobenzenethiol; 2-Fluorophenyl mercaptan; MFCD00041419; ortho-fluorobenzenethiol; 2-Fluorobenzenethiol; 2-Fluorothiophenol; o-Fluorothiophenol; 2-fluorobenzene thiol; 2-Mercaptofluorobenzene; 2-Fluoro thiophenol |
| Molecular Formula | C6H5FS |
| Molecular Weight | 128.167 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 162.7±13.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Sealed in a cool, dry environment |
| Packaging | III |
| HTC | 2930909090 |
| SMILES | Fc1ccccc1S |
| InChI | InChI=1S/C6H5FS/c7-5-3-1-2-4-6(5)8/h1-4,8H/p-1 |
| InChI Key | WJTZZPVVTSDNJJ-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/3183_1_2557_78_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 3336 Proper shipping name: Mercaptan, Liquid, Flammable, Not Otherwise Specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Fluorophenylacetonitrile | 326-62-5 | 2A-9003175 |
| 2-Fluorophenylacetyl chloride | 451-81-0 | 2A-9003176 |
| 2-Fluorophenylhydrazine hydrochloride | 2924-15-4 | 2A-9003178 |
| 2'-Fluoropropiophenone | 446-22-0 | 2A-9003179 |
| 2-Fluorothioanisole | 655-20-9 | 2A-9003182 |
| 2-Formylcinnamic acid | 130036-17-8 | 2A-9003184 |
| 2-Heptafluoropropoxy-4H,4H-perfluoro-3,5-nonanedione | 2A-103192 | 2A-9003192 |
| 2-Heptafluoropropoxyundecafluoro-3,5-octanedione | 2A-103193 | 2A-9003193 |
| 2-heptanol | 543-49-7 | 2A-9003194 |
| 2-Heptyl malonic acid | 760-54-3 | 2A-9003196 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA