
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5434-30-0 |
| Catalog No. | 2A-9031819 |
| Chinese Name | 5'-氨基-2'-甲基乙酰苯胺 |
| Synonyms | N-(5-amino-2-methylphenyl)acetamide |
| Molecular Formula | C9H12O1N2 |
| Molecular Weight | 164.21 |
| Purity | 98.00 |
| Density | 1.163g/cm3 |
| Boiling Point | 362.1ºC at 760mmHg |
| Melting Point | 141ºC |
| Appearance | Solid;White to Light yellow powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | room temperature, dry |
| HTC | 2924299090 |
| MDL Number | MFCD00047859 |
| SMILES | CC(=O)Nc1cc(N)ccc1C |
| InChI | InChI=1S/C9H12N2O/c1-6-3-4-8(10)5-9(6)11-7(2)12/h3-5H,10H2,1-2H3,(H,11,12) |
| InChI Key | UAZGSMMESOKKQZ-UHFFFAOYSA-N |
| MSDS | msds/31819_1_5434_30_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methyl-5-nitrophenol | 5428-54-6 | 2A-9031811 |
| 5-Chloropyrimidin-2-amine | 5428-89-7 | 2A-9031812 |
| 2-Acetamidoacrylic acid | 5429-56-1 | 2A-9031813 |
| 3-Bromocumene | 5433-01-2 | 2A-9031816 |
| 4-Aminophthalic acid | 5434-21-9 | 2A-9031817 |
| Benzyl 2-bromoacetate | 5437-45-6 | 2A-9031825 |
| 2-Amino-1-piperidin-1-ylethanone hydrochloride | 5437-48-9 | 2A-9031826 |
| Dimethyl nitromalonate | 5437-67-2 | 2A-9031827 |
| 1,2-Dibromonaphthalene | 5438-13-1 | 2A-9031829 |
| 2-Acetyloxy-2-phenyl-acetic acid | 5438-68-6 | 2A-9031831 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA