
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5434-29-7 |
| Catalog No. | 2A-9031818 |
| Chinese Name | 2,4-二甲基吡咯-3,5-二羧酸 |
| Synonyms | 3,5-dimethyl-pyrrole-2,4-dicarboxylic acid; 3,5-Dimethyl-pyrrol-2,4-dicarbonsaeure; 2,4-Dimethyl-1H-pyrrole-3,5-dicarboxylic acid |
| Molecular Formula | C8H9O4N1 |
| Molecular Weight | 183.16 |
| Purity | 98.00 |
| Density | 1.461 g/cm3 |
| Boiling Point | 456.8ºC at 760 mmHg |
| Storage Condition | -20°C, dry and sealed |
| HTC | 2933990090 |
| MDL Number | MFCD00826671 |
| SMILES | Cc1[nH]c(C([O-])=O)c(C)c1C([O-])=O |
| InChI | InChI=1S/C8H9NO4/c1-3-5(7(10)11)4(2)9-6(3)8(12)13/h9H,1-2H3,(H,10,11)(H,12,13)/p-2 |
| InChI Key | InChIKey=LGAFIBCWNKPENX-UHFFFAOYSA-L |
| MSDS | msds/31818_1_5434_29_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 5-Fluoro-3-methyl-1H-pyrimidine-2,4-dione | 4840-69-1 | 2A-9031258 |
| 2,4-Dimethoxy-1-nitrobenzene | 4920-84-7 | 2A-9031319 |
| (2,4-Dichlorobenzyl)methylamine | 5013-77-4 | 2A-9031381 |
| 2,4-Dichloro-5-aminopyrimidine | 5177-27-5 | 2A-9031509 |
| 6-Nitro-1,2,4-diazo acid | 5366-84-7 | 2A-9031710 |
| 2,4-Dichlorophenoxyacetic acid diethanolamine salt | 5742-19-8 | 2A-9032123 |
| Coumatetralyl | 5836-29-3 | 2A-9032203 |
| 2,4-Diamino-6-nonyl-1,3,5-triazine | 5921-65-3 | 2A-9032317 |
| 2,4-Dichloro-3-nitropyridine | 5975-12-2 | 2A-9032365 |
| 2,4-Dihydroxy-3-methylbenzaldehyde | 6248-20-0 | 2A-9032626 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA