
CAS Number5418-63-3
Synonyms3H-Indolium, 1,2,3,3-tetramethyl-, iodide (1:1); 1,2,3,3-Tetramethyl-3H-indolium iodide; 1,2,3,3-tetramethylindol-1-ium,iodide; EINECS 226-526-2; MFCD00013333
Molecular FormulaC12H16IN
Molecular Weight301.17
Purity98%
Melting Point258 °C (dec.) (lit.)
Appearancepowder or crystals
EINECS226-526-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5418-63-3 |
| Catalog No. | 2A-9031787 |
| Chinese Name | 1,2,3,3-四甲基-3H-碘代吲哚 |
| Synonyms | 3H-Indolium, 1,2,3,3-tetramethyl-, iodide (1:1); 1,2,3,3-Tetramethyl-3H-indolium iodide; 1,2,3,3-tetramethylindol-1-ium,iodide; EINECS 226-526-2; MFCD00013333 |
| Molecular Formula | C12H16IN |
| Molecular Weight | 301.17 |
| Purity | 98 |
| Melting Point | 258 °C (dec.) (lit.) |
| Appearance | powder or crystals |
| Storage Condition | Store in airtight, cool and dry place |
| EINECS | 226-526-2 |
| HTC | 2933990090 |
| PubChem ID | 24859762 |
| MDL Number | MFCD00013333 |
| SMILES | [I-].CC1=[N+](C)c2ccccc2C1(C)C |
| InChI | 1S/C12H16N.HI/c1-9-12(2,3)10-7-5-6-8-11(10)13(9)4;/h5-8H,1-4H3;1H/q+1;/p-1 |
| InChI Key | HCYIOKVZAATOEW-UHFFFAOYSA-M |
| NACRES Code | NA.47 |
| UNSPSC | 12171500 |
| MSDS | msds/31787_1_5418_63_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,7-Dinitrofluorene | 5405-53-8 | 2A-9031766 |
| L-Lysine L-glutamate | 5408-52-6 | 2A-9031771 |
| 3,4-Diethoxybenzoic acid | 5409-31-4 | 2A-9031774 |
| 1,2-Phenylenedioxydiacetic acid | 5411-14-3 | 2A-9031777 |
| 2-(1-Ethoxyethylidene)malononitrile | 5417-82-3 | 2A-9031785 |
| Triisopropyl borate | 5419-55-6 | 2A-9031789 |
| Sodium 5-hydroxynaphthalene-1-sulphonate | 5419-77-2 | 2A-9031790 |
| N-(1-Nitro-2-naphthalenyl)acetamide | 5419-82-9 | 2A-9031791 |
| Ammonium thioglycolate | 5421-46-5 | 2A-9031792 |
| Basic Brown 4 | 5421-66-9 | 2A-9031793 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA