
CAS Number5409-15-4
Synonyms4-chloro-1-hydroxy-2-naphthalenecarboxylic acid; 4-chloro-1-hydroxy-naphthalene-2-carboxylic acid; 2-Naphthoic acid,4-chloro-1-hydroxy; 2-Naphthalenecarboxylic acid,4-chloro-1-hydroxy; 4-Chloro-1-hydroxy-2-naphthoic acid
Molecular FormulaC11H7ClO3
Molecular Weight291.55
Purity98.00%
Density1.52g/cm3
Boiling Point393.1ºC at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5409-15-4 |
| Catalog No. | 2A-9031773 |
| Chinese Name | 4-氯-1-羟基萘-2-甲酸 |
| Synonyms | 4-chloro-1-hydroxy-2-naphthalenecarboxylic acid; 4-chloro-1-hydroxy-naphthalene-2-carboxylic acid; 2-Naphthoic acid,4-chloro-1-hydroxy; 2-Naphthalenecarboxylic acid,4-chloro-1-hydroxy; 4-Chloro-1-hydroxy-2-naphthoic acid |
| Molecular Formula | C11H7ClO3 |
| Molecular Weight | 291.55 |
| Purity | 98.00 |
| Density | 1.52g/cm3 |
| Boiling Point | 393.1ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918290000 |
| PubChem ID | 329779193 |
| MDL Number | MFCD08442559 |
| SMILES | OC(=O)c1sc2cccc(Br)c2c1Cl |
| InChI | 1S/C9H4BrClO2S/c10-4-2-1-3-5-6(4)7(11)8(14-5)9(12)13/h1-3H,(H,12,13) |
| InChI Key | ROFHSMQAACOXBC-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Phenyl-3-thiosemicarbazide | 5351-69-9 | 2A-9031701 |
| Hagemann's ester (Ethyl 2-methyl-4-oxo-2-cyclohexene-1-carboxylate) | 487-51-4 | 2A-9031718 |
| 6-Bromoveratraldehyde | 5392-10-9 | 2A-9031739 |
| 4-Methylsulphonyl benzaldehyde | 5398-77-6 | 2A-9031752 |
| Dodecanohydrazide | 5399-22-4 | 2A-9031754 |
| 2-Chloroveratraldehyde | 5417-17-4 | 2A-9031784 |
| 1,1-Cyclobutanedicarboxylic acid | 5445-51-2 | 2A-9031845 |
| 3,4-Dibenzyloxybenzaldehyde | 5447-02-9 | 2A-9031849 |
| 5-Norbornene-2-carboxaldehyde | 5453-80-5 | 2A-9031858 |
| 4-Bromophenylboronic acid | 5467-74-3 | 2A-9031892 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA