
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5346-53-2 |
| Catalog No. | 2A-9031689 |
| Chinese Name | 1-羟乙基-4-氰基-5-氨基吡唑 |
| Synonyms | 5-amino-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
| Molecular Formula | C10H10FN5O |
| Molecular Weight | 152.15400 |
| Purity | 98.00 |
| Density | 1.42g/cm3 |
| Boiling Point | 424.9ºC at 760 mmHg |
| Melting Point | 158-160 °C |
| Appearance | Off-white solid |
| Storage Condition | 2-8°C, store away from light, dry and sealed |
| HTC | 2933199090 |
| SMILES | NC(N(C(C=CC=C1)=C1F)N=C2)=C2C(NN)=O |
| InChI | 1S/C10H10FN5O/c11-7-3-1-2-4-8(7)16-9(12)6(5-14-16)10(17)15-13/h1-5H,12-13H2,(H,15,17) |
| InChI Key | ZYBIAUHQEMAAKF-UHFFFAOYSA-N |
| UNSPSC | 12352125 |
| MSDS | msds/31689_1_5346_53_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Nitropyrazole-3-carboxylic acid | 5334-40-7 | 2A-9031661 |
| 1-Methyl-4-cyano-5-amino-1,2-pyrazole | 5334-41-8 | 2A-9031662 |
| 5-Amino-1-phenylpyrazole-3-carbonitrile | 5334-43-0 | 2A-9031663 |
| 3-Bromo-6-methoxypyridazine | 17321-29-8 | 2A-9031673 |
| 4-Pyridineethanol | 5344-27-4 | 2A-9031677 |
| 1-N-Benzyl-2-phenylpiperazine | 5368-33-2 | 2A-9031715 |
| 3,4-Bis(chloromethyl)-2,5-dimethylthiophene | 5368-70-7 | 2A-9031716 |
| 3-(4-Methylphenyl)-5-(trichloromethyl)-1,2,4-oxadiazole | 5373-86-4 | 2A-9031723 |
| 1-Benzothiophene-3-carbaldehyde | 5381-20-4 | 2A-9031725 |
| 3-Hydroxymetnylbenzo[b]thiophene | 5381-24-8 | 2A-9031726 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA